| General Information | |
|---|---|
| ZINC ID | ZINC000028962218 |
| Molecular Weight (Da) | 398 |
| SMILES | O=C(NC1CCCCCC1)c1cn(CCN2CCOCC2)c2ccccc2c1=O |
| Molecular Formula | C23N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.49 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 3.466 |
| Activity (Ki) in nM | 28.184 |
| Polar Surface Area (PSA) | 63.57 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94707578 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.57 |
| Ilogp | 3.3 |
| Xlogp3 | 3.2 |
| Wlogp | 2.41 |
| Mlogp | 1.57 |
| Silicos-it log p | 3.19 |
| Consensus log p | 2.73 |
| Esol log s | -4.18 |
| Esol solubility (mg/ml) | 0.0263 |
| Esol solubility (mol/l) | 0.0000661 |
| Esol class | Moderately |
| Ali log s | -4.21 |
| Ali solubility (mg/ml) | 0.0247 |
| Ali solubility (mol/l) | 0.0000621 |
| Ali class | Moderately |
| Silicos-it logsw | -5.42 |
| Silicos-it solubility (mg/ml) | 0.00152 |
| Silicos-it solubility (mol/l) | 0.00000382 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.45 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.09 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.068 |
| Logd | 2.888 |
| Logp | 3.145 |
| F (20%) | 0.047 |
| F (30%) | 0.187 |
| Mdck | 3.46E-05 |
| Ppb | 0.7797 |
| Vdss | 1.745 |
| Fu | 0.1715 |
| Cyp1a2-inh | 0.163 |
| Cyp1a2-sub | 0.511 |
| Cyp2c19-inh | 0.635 |
| Cyp2c19-sub | 0.622 |
| Cl | 3.318 |
| T12 | 0.031 |
| H-ht | 0.231 |
| Dili | 0.321 |
| Roa | 0.733 |
| Fdamdd | 0.047 |
| Skinsen | 0.46 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.136 |
| Bcf | 0.536 |
| Igc50 | 3.24 |
| Lc50 | 3.369 |
| Lc50dm | 4.345 |
| Nr-ar | 0.146 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.322 |
| Nr-aromatase | 0.193 |
| Nr-er | 0.279 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.014 |
| Sr-are | 0.441 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.109 |
| Sr-mmp | 0.074 |
| Sr-p53 | 0.054 |
| Vol | 415.68 |
| Dense | 0.956 |
| Flex | 0.231 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.788 |
| Synth | 2.236 |
| Fsp3 | 0.565 |
| Mce-18 | 52.222 |
| Natural product-likeness | -1.394 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |