| General Information | |
|---|---|
| ZINC ID | ZINC000029037972 |
| Molecular Weight (Da) | 437 |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2S(C)(=O)=O)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C20N2O5S2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.201 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 2.661 |
| Activity (Ki) in nM | 6.026 |
| Polar Surface Area (PSA) | 117.38 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 1.001513 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.35 |
| Ilogp | 2.44 |
| Xlogp3 | 2.9 |
| Wlogp | 4.42 |
| Mlogp | 2.02 |
| Silicos-it log p | 1.87 |
| Consensus log p | 2.73 |
| Esol log s | -4.28 |
| Esol solubility (mg/ml) | 2.27E-02 |
| Esol solubility (mol/l) | 5.20E-05 |
| Esol class | Moderately |
| Ali log s | -5.03 |
| Ali solubility (mg/ml) | 4.12E-03 |
| Ali solubility (mol/l) | 9.43E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -6.15 |
| Silicos-it solubility (mg/ml) | 3.07E-04 |
| Silicos-it solubility (mol/l) | 7.03E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.9 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.758 |
| Logd | 2.292 |
| Logp | 2.804 |
| F (20%) | 0.003 |
| F (30%) | 0.154 |
| Mdck | 2.42E-05 |
| Ppb | 0.9646 |
| Vdss | 0.367 |
| Fu | 0.0235 |
| Cyp1a2-inh | 0.233 |
| Cyp1a2-sub | 0.806 |
| Cyp2c19-inh | 0.28 |
| Cyp2c19-sub | 0.638 |
| Cl | 0.716 |
| T12 | 0.141 |
| H-ht | 0.816 |
| Dili | 0.994 |
| Roa | 0.341 |
| Fdamdd | 0.921 |
| Skinsen | 0.049 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.015 |
| Bcf | 0.446 |
| Igc50 | 3.109 |
| Lc50 | 4.314 |
| Lc50dm | 4.056 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.243 |
| Nr-aromatase | 0.088 |
| Nr-er | 0.05 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.395 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.004 |
| Sr-mmp | 0.838 |
| Sr-p53 | 0.004 |
| Vol | 413.314 |
| Dense | 1.055 |
| Flex | 23 |
| Nstereo | 0.261 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.777 |
| Fsp3 | 2.067 |
| Mce-18 | 0.35 |
| Natural product-likeness | 52.148 |
| Alarm nmr | -2.037 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Accepted |
| Goldentriangle | Rejected |