| General Information | |
|---|---|
| ZINC ID | ZINC000029037978 |
| Molecular Weight (Da) | 393 |
| SMILES | Cc1ccc(C(=O)N[C@H](C)C2CCCCC2)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C21N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.832 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 4.125 |
| Activity (Ki) in nM | 18.197 |
| Polar Surface Area (PSA) | 74.86 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.77227991 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.67 |
| Ilogp | 3.75 |
| Xlogp3 | 4.36 |
| Wlogp | 4.57 |
| Mlogp | 2.88 |
| Silicos-it log p | 3.21 |
| Consensus log p | 3.75 |
| Esol log s | -4.79 |
| Esol solubility (mg/ml) | 6.38E-03 |
| Esol solubility (mol/l) | 1.63E-05 |
| Esol class | Moderately |
| Ali log s | -5.65 |
| Ali solubility (mg/ml) | 8.84E-04 |
| Ali solubility (mol/l) | 2.25E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -5.24 |
| Silicos-it solubility (mg/ml) | 2.29E-03 |
| Silicos-it solubility (mol/l) | 5.82E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.6 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.61 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.553 |
| Logd | 3.986 |
| Logp | 5.271 |
| F (20%) | 0.96 |
| F (30%) | 0.078 |
| Mdck | 1.99E-05 |
| Ppb | 0.9782 |
| Vdss | 0.636 |
| Fu | 0.0192 |
| Cyp1a2-inh | 0.317 |
| Cyp1a2-sub | 0.912 |
| Cyp2c19-inh | 0.713 |
| Cyp2c19-sub | 0.553 |
| Cl | 2.573 |
| T12 | 0.091 |
| H-ht | 0.752 |
| Dili | 0.948 |
| Roa | 0.079 |
| Fdamdd | 0.445 |
| Skinsen | 0.037 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.099 |
| Bcf | 1.167 |
| Igc50 | 4.784 |
| Lc50 | 5.244 |
| Lc50dm | 4.499 |
| Nr-ar | 0.03 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.043 |
| Nr-aromatase | 0.93 |
| Nr-er | 0.299 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.08 |
| Sr-are | 0.687 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.078 |
| Sr-mmp | 0.846 |
| Sr-p53 | 0.026 |
| Vol | 402.43 |
| Dense | 0.975 |
| Flex | 21 |
| Nstereo | 0.286 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.827 |
| Fsp3 | 2.568 |
| Mce-18 | 0.667 |
| Natural product-likeness | 68.943 |
| Alarm nmr | -1.58 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |