| General Information | |
|---|---|
| ZINC ID | ZINC000029038111 |
| Molecular Weight (Da) | 448 |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3CCCC[C@H]3C2)cc1S(=O)(=O)N1CCN(C(C)C)CC1 |
| Molecular Formula | C24N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.202 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 3.56 |
| Activity (Ki) in nM | 588.844 |
| Polar Surface Area (PSA) | 69.31 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.7131145 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.71 |
| Ilogp | 3.74 |
| Xlogp3 | 3.91 |
| Wlogp | 3.3 |
| Mlogp | 2.72 |
| Silicos-it log p | 2.42 |
| Consensus log p | 3.22 |
| Esol log s | -4.89 |
| Esol solubility (mg/ml) | 5.74E-03 |
| Esol solubility (mol/l) | 1.28E-05 |
| Esol class | Moderately |
| Ali log s | -5.06 |
| Ali solubility (mg/ml) | 3.86E-03 |
| Ali solubility (mol/l) | 8.63E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -4.51 |
| Silicos-it solubility (mg/ml) | 1.37E-02 |
| Silicos-it solubility (mol/l) | 3.07E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.25 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.3 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.186 |
| Logd | 3.527 |
| Logp | 3.967 |
| F (20%) | 0.988 |
| F (30%) | 0.043 |
| Mdck | 1.01E-05 |
| Ppb | 0.9109 |
| Vdss | 1.788 |
| Fu | 0.0662 |
| Cyp1a2-inh | 0.094 |
| Cyp1a2-sub | 0.295 |
| Cyp2c19-inh | 0.246 |
| Cyp2c19-sub | 0.921 |
| Cl | 3.815 |
| T12 | 0.088 |
| H-ht | 0.604 |
| Dili | 0.939 |
| Roa | 0.052 |
| Fdamdd | 0.076 |
| Skinsen | 0.056 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.931 |
| Bcf | 0.608 |
| Igc50 | 3.538 |
| Lc50 | 4.355 |
| Lc50dm | 3.494 |
| Nr-ar | 0.129 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.037 |
| Nr-aromatase | 0.137 |
| Nr-er | 0.214 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.473 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.094 |
| Sr-p53 | 0.008 |
| Vol | 456.758 |
| Dense | 0.979 |
| Flex | 26 |
| Nstereo | 0.192 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.71 |
| Fsp3 | 3.036 |
| Mce-18 | 0.708 |
| Natural product-likeness | 90.854 |
| Alarm nmr | -1.719 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |