| General Information | |
|---|---|
| ZINC ID | ZINC000029043248 |
| Molecular Weight (Da) | 292 |
| SMILES | CC(=O)Cn1nnc(Cc2ccc(-c3ccccc3)cc2)n1 |
| Molecular Formula | C17N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 87.562 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| LogP | 2.698 |
| Activity (Ki) in nM | 5248.075 |
| Polar Surface Area (PSA) | 60.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95156794 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.18 |
| Ilogp | 2.48 |
| Xlogp3 | 3.56 |
| Wlogp | 2.52 |
| Mlogp | 1.97 |
| Silicos-it log p | 3.04 |
| Consensus log p | 2.71 |
| Esol log s | -4.14 |
| Esol solubility (mg/ml) | 2.13E-02 |
| Esol solubility (mol/l) | 7.29E-05 |
| Esol class | Moderately |
| Ali log s | -4.52 |
| Ali solubility (mg/ml) | 8.84E-03 |
| Ali solubility (mol/l) | 3.02E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.84 |
| Silicos-it solubility (mg/ml) | 4.25E-04 |
| Silicos-it solubility (mol/l) | 1.46E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.56 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.81 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.78 |
| Logd | 2.539 |
| Logp | 2.694 |
| F (20%) | 0.142 |
| F (30%) | 0.523 |
| Mdck | 3.82E-05 |
| Ppb | 0.8948 |
| Vdss | 1.291 |
| Fu | 0.0706 |
| Cyp1a2-inh | 0.814 |
| Cyp1a2-sub | 0.134 |
| Cyp2c19-inh | 0.94 |
| Cyp2c19-sub | 0.295 |
| Cl | 10.33 |
| T12 | 0.464 |
| H-ht | 0.19 |
| Dili | 0.982 |
| Roa | 0.267 |
| Fdamdd | 0.021 |
| Skinsen | 0.233 |
| Ec | 0.003 |
| Ei | 0.116 |
| Respiratory | 0.083 |
| Bcf | 0.846 |
| Igc50 | 2.996 |
| Lc50 | 4.13 |
| Lc50dm | 3.732 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.038 |
| Nr-aromatase | 0.01 |
| Nr-er | 0.504 |
| Nr-er-lbd | 0.028 |
| Nr-ppar-gamma | 0.799 |
| Sr-are | 0.45 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.003 |
| Sr-mmp | 0.069 |
| Sr-p53 | 0.001 |
| Vol | 305.968 |
| Dense | 0.955 |
| Flex | 18 |
| Nstereo | 0.278 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.725 |
| Fsp3 | 2.107 |
| Mce-18 | 0.176 |
| Natural product-likeness | 15 |
| Alarm nmr | -1.198 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Accepted |