| General Information | |
|---|---|
| ZINC ID | ZINC000029045392 |
| Molecular Weight (Da) | 395 |
| SMILES | Cc1ccc(C(=O)NC2[C@@H](C)CCC[C@@H]2C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C20N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.559 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 2.826 |
| Activity (Ki) in nM | 43.652 |
| Polar Surface Area (PSA) | 84.09 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0406351 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.32 |
| Xlogp3 | 3.02 |
| Wlogp | 3.27 |
| Mlogp | 1.85 |
| Silicos-it log p | 2.18 |
| Consensus log p | 2.73 |
| Esol log s | -4.02 |
| Esol solubility (mg/ml) | 0.0374 |
| Esol solubility (mol/l) | 0.0000948 |
| Esol class | Moderately |
| Ali log s | -4.45 |
| Ali solubility (mg/ml) | 0.014 |
| Ali solubility (mol/l) | 0.0000354 |
| Ali class | Moderately |
| Silicos-it logsw | -4.57 |
| Silicos-it solubility (mg/ml) | 0.0105 |
| Silicos-it solubility (mol/l) | 0.0000267 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.56 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.324 |
| Logd | 3.222 |
| Logp | 3.639 |
| F (20%) | 0.075 |
| F (30%) | 0.008 |
| Mdck | 1.81E-05 |
| Ppb | 0.9694 |
| Vdss | 0.866 |
| Fu | 0.0453 |
| Cyp1a2-inh | 0.142 |
| Cyp1a2-sub | 0.103 |
| Cyp2c19-inh | 0.289 |
| Cyp2c19-sub | 0.824 |
| Cl | 6.169 |
| T12 | 0.107 |
| H-ht | 0.36 |
| Dili | 0.975 |
| Roa | 0.083 |
| Fdamdd | 0.097 |
| Skinsen | 0.056 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.082 |
| Bcf | 0.499 |
| Igc50 | 2.556 |
| Lc50 | 3.424 |
| Lc50dm | 4.047 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.059 |
| Nr-aromatase | 0.926 |
| Nr-er | 0.285 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.683 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.013 |
| Sr-mmp | 0.664 |
| Sr-p53 | 0.009 |
| Vol | 393.924 |
| Dense | 1.001 |
| Flex | 0.238 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.852 |
| Synth | 3.068 |
| Fsp3 | 0.65 |
| Mce-18 | 72.121 |
| Natural product-likeness | -1.546 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |