| General Information | |
|---|---|
| ZINC ID | ZINC000030691168 |
| Molecular Weight (Da) | 378 |
| SMILES | COc1ccc(C(=O)c2c(C)n(CCN3CCOCC3)c3ccccc23)cc1 |
| Molecular Formula | C23N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 108.954 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 3.599 |
| Activity (Ki) in nM | 457.088 |
| Polar Surface Area (PSA) | 43.7 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.76549804 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.35 |
| Ilogp | 3.81 |
| Xlogp3 | 3.31 |
| Wlogp | 3.14 |
| Mlogp | 1.87 |
| Silicos-it log p | 4.16 |
| Consensus log p | 3.26 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 0.0202 |
| Esol solubility (mol/l) | 0.0000534 |
| Esol class | Moderately |
| Ali log s | -3.9 |
| Ali solubility (mg/ml) | 0.0472 |
| Ali solubility (mol/l) | 0.000125 |
| Ali class | Soluble |
| Silicos-it logsw | -6.37 |
| Silicos-it solubility (mg/ml) | 0.00016 |
| Silicos-it solubility (mol/l) | 0.00000042 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.26 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.97 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.932 |
| Logd | 3.356 |
| Logp | 3.539 |
| F (20%) | 0.012 |
| F (30%) | 0.508 |
| Mdck | - |
| Ppb | 95.44% |
| Vdss | 1.638 |
| Fu | 2.52% |
| Cyp1a2-inh | 0.594 |
| Cyp1a2-sub | 0.877 |
| Cyp2c19-inh | 0.723 |
| Cyp2c19-sub | 0.55 |
| Cl | 9.425 |
| T12 | 0.027 |
| H-ht | 0.545 |
| Dili | 0.854 |
| Roa | 0.548 |
| Fdamdd | 0.044 |
| Skinsen | 0.111 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.494 |
| Bcf | 1.751 |
| Igc50 | 4.195 |
| Lc50 | 5.579 |
| Lc50dm | 5.848 |
| Nr-ar | 0.024 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.685 |
| Nr-aromatase | 0.088 |
| Nr-er | 0.267 |
| Nr-er-lbd | 0.054 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.534 |
| Sr-atad5 | 0.026 |
| Sr-hse | 0.003 |
| Sr-mmp | 0.082 |
| Sr-p53 | 0.179 |
| Vol | 399.411 |
| Dense | 0.947 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.616 |
| Synth | 2.117 |
| Fsp3 | 0.348 |
| Mce-18 | 47.419 |
| Natural product-likeness | -1.066 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |