| General Information | |
|---|---|
| ZINC ID | ZINC000034577680 |
| Molecular Weight (Da) | 341 |
| SMILES | CCCn1c(C)c(C(=O)c2cccc3ccc(C)cc23)c2ccccc21 |
| Molecular Formula | C24N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.161 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| LogP | 6.056 |
| Activity (Ki) in nM | 346.737 |
| Polar Surface Area (PSA) | 22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.20741295 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.21 |
| Ilogp | 3.63 |
| Xlogp3 | 6.19 |
| Wlogp | 6.05 |
| Mlogp | 4.19 |
| Silicos-it log p | 6.26 |
| Consensus log p | 5.26 |
| Esol log s | -6.13 |
| Esol solubility (mg/ml) | 0.000251 |
| Esol solubility (mol/l) | 0.00000073 |
| Esol class | Poorly sol |
| Ali log s | -6.44 |
| Ali solubility (mg/ml) | 0.000125 |
| Ali solubility (mol/l) | 0.00000036 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.54 |
| Silicos-it solubility (mg/ml) | 0.00000099 |
| Silicos-it solubility (mol/l) | 2.91E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.99 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.267 |
| Logd | 4.609 |
| Logp | 6.11 |
| F (20%) | 0.585 |
| F (30%) | 0.989 |
| Mdck | - |
| Ppb | 99.35% |
| Vdss | 1.056 |
| Fu | 0.61% |
| Cyp1a2-inh | 0.787 |
| Cyp1a2-sub | 0.733 |
| Cyp2c19-inh | 0.821 |
| Cyp2c19-sub | 0.102 |
| Cl | 6.28 |
| T12 | 0.012 |
| H-ht | 0.158 |
| Dili | 0.904 |
| Roa | 0.1 |
| Fdamdd | 0.949 |
| Skinsen | 0.092 |
| Ec | 0.003 |
| Ei | 0.937 |
| Respiratory | 0.153 |
| Bcf | 2.288 |
| Igc50 | 5.307 |
| Lc50 | 6.409 |
| Lc50dm | 6.774 |
| Nr-ar | 0.037 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.846 |
| Nr-aromatase | 0.652 |
| Nr-er | 0.777 |
| Nr-er-lbd | 0.369 |
| Nr-ppar-gamma | 0.011 |
| Sr-are | 0.587 |
| Sr-atad5 | 0.169 |
| Sr-hse | 0.02 |
| Sr-mmp | 0.784 |
| Sr-p53 | 0.45 |
| Vol | 382.857 |
| Dense | 0.891 |
| Flex | 0.182 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.414 |
| Synth | 2.096 |
| Fsp3 | 0.208 |
| Mce-18 | 22 |
| Natural product-likeness | -0.81 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |