| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000035050266 |
| Molecular Weight (Da) | 384 |
| SMILES | O=C(NC1CCCCC1)c1cn(CCN2CCOCC2)c2ncccc2c1=O |
| Molecular Formula | C21N4O3 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000035050266 |
| Molecular Weight (Da) | 384 |
| SMILES | O=C(NC1CCCCC1)c1cn(CCN2CCOCC2)c2ncccc2c1=O |
| Molecular Formula | C21N4O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000035050266 |
| Molar Refractivity | 106.305 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 2.319 |
| Activity (Ki) in nM | 67.608 |
| Polar Surface Area (PSA) | 76.46 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000035050266 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | + |
| Oct2 inhibitor | + |
| Bsep inhibitor | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.80061435 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.57 |
| Ilogp | 3.09 |
| Xlogp3 | 1.92 |
| Wlogp | 1.41 |
| Mlogp | 1.01 |
| Silicos-it log p | 2.39 |
| Consensus log p | 1.96 |
| Esol log s | -3.3 |
| Esol solubility (mg/ml) | 1.92E-01 |
| Esol solubility (mol/l) | 4.99E-04 |
| Esol class | Soluble |
| Ali log s | -3.15 |
| Ali solubility (mg/ml) | 2.73E-01 |
| Ali solubility (mol/l) | 7.09E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.78 |
| Silicos-it solubility (mg/ml) | 6.42E-03 |
| Silicos-it solubility (mol/l) | 1.67E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.28 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.03 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -3.46 |
| Logd | 1.895 |
| Logp | 1.604 |
| F (20%) | 0.145 |
| F (30%) | 0.249 |
| Mdck | 2.66E-05 |
| Ppb | 0.5166 |
| Vdss | 1.812 |
| Fu | 0.5441 |
| Cyp1a2-inh | 0.069 |
| Cyp1a2-sub | 0.252 |
| Cyp2c19-inh | 0.242 |
| Cyp2c19-sub | 0.642 |
| Cl | 2.842 |
| T12 | 0.071 |
| H-ht | 0.205 |
| Dili | 0.675 |
| Roa | 0.602 |
| Fdamdd | 0.035 |
| Skinsen | 0.524 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.065 |
| Bcf | 0.408 |
| Igc50 | 2.074 |
| Lc50 | 2.44 |
| Lc50dm | 3.869 |
| Nr-ar | 0.069 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.066 |
| Nr-aromatase | 0.136 |
| Nr-er | 0.254 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.016 |
| Sr-are | 0.44 |
| Sr-atad5 | 0.026 |
| Sr-hse | 0.107 |
| Sr-mmp | 0.04 |
| Sr-p53 | 0.033 |
| Vol | 392.085 |
| Dense | 0.98 |
| Flex | 25 |
| Nstereo | 0.24 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.851 |
| Fsp3 | 2.357 |
| Mce-18 | 0.571 |
| Natural product-likeness | 52.121 |
| Alarm nmr | -1.518 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |