| General Information | |
|---|---|
| ZINC ID | ZINC000035075482 |
| Molecular Weight (Da) | 434 |
| SMILES | Cc1ccc2c(c1)Cc1c(C(=O)Nc3ccccc3)nn(-c3ccc(Cl)cc3Cl)c1-2 |
| Molecular Formula | C24Cl2N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.873 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 6.706 |
| Activity (Ki) in nM | 33.113 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.131 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.08 |
| Ilogp | 4.22 |
| Xlogp3 | 6.34 |
| Wlogp | 6.12 |
| Mlogp | 5.09 |
| Silicos-it log p | 5.86 |
| Consensus log p | 5.52 |
| Esol log s | -6.83 |
| Esol solubility (mg/ml) | 0.0000642 |
| Esol solubility (mol/l) | 0.00000014 |
| Esol class | Poorly sol |
| Ali log s | -7.12 |
| Ali solubility (mg/ml) | 0.0000333 |
| Ali solubility (mol/l) | 7.66E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.74 |
| Silicos-it solubility (mg/ml) | 7.85E-08 |
| Silicos-it solubility (mol/l) | 1.81E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.45 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.582 |
| Logd | 4.62 |
| Logp | 6.225 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 9.60E-06 |
| Ppb | 0.9932 |
| Vdss | 1.269 |
| Fu | 0.0139 |
| Cyp1a2-inh | 0.197 |
| Cyp1a2-sub | 0.59 |
| Cyp2c19-inh | 0.907 |
| Cyp2c19-sub | 0.272 |
| Cl | 4.908 |
| T12 | 0.063 |
| H-ht | 0.709 |
| Dili | 0.973 |
| Roa | 0.364 |
| Fdamdd | 0.9 |
| Skinsen | 0.057 |
| Ec | 0.003 |
| Ei | 0.025 |
| Respiratory | 0.491 |
| Bcf | 3.053 |
| Igc50 | 5.171 |
| Lc50 | 6.782 |
| Lc50dm | 5.748 |
| Nr-ar | 0.032 |
| Nr-ar-lbd | 0.05 |
| Nr-ahr | 0.956 |
| Nr-aromatase | 0.923 |
| Nr-er | 0.861 |
| Nr-er-lbd | 0.367 |
| Nr-ppar-gamma | 0.947 |
| Sr-are | 0.951 |
| Sr-atad5 | 0.64 |
| Sr-hse | 0.585 |
| Sr-mmp | 0.972 |
| Sr-p53 | 0.961 |
| Vol | 421.443 |
| Dense | 1.028 |
| Flex | 0.148 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.362 |
| Synth | 2.268 |
| Fsp3 | 0.083 |
| Mce-18 | 56.077 |
| Natural product-likeness | -1.6 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |