| General Information | |
|---|---|
| ZINC ID | ZINC000035075497 |
| Molecular Weight (Da) | 448 |
| SMILES | Cc1ccc(NC(=O)c2nn(-c3ccc(Cl)cc3Cl)c3c2Cc2cc(C)ccc2-3)cc1 |
| Molecular Formula | C25Cl2N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.914 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| LogP | 7.192 |
| Activity (Ki) in nM | 74.131 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.35925602 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.12 |
| Ilogp | 4.48 |
| Xlogp3 | 6.71 |
| Wlogp | 6.43 |
| Mlogp | 5.29 |
| Silicos-it log p | 6.38 |
| Consensus log p | 5.86 |
| Esol log s | -7.13 |
| Esol solubility (mg/ml) | 3.31E-05 |
| Esol solubility (mol/l) | 7.38E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.5 |
| Ali solubility (mg/ml) | 1.42E-05 |
| Ali solubility (mol/l) | 3.17E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.12 |
| Silicos-it solubility (mg/ml) | 3.42E-08 |
| Silicos-it solubility (mol/l) | 7.64E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.27 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.5 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.739 |
| Logd | 4.713 |
| Logp | 6.569 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 9.78E-06 |
| Ppb | 0.9969 |
| Vdss | 1.218 |
| Fu | 0.0153 |
| Cyp1a2-inh | 0.13 |
| Cyp1a2-sub | 0.822 |
| Cyp2c19-inh | 0.854 |
| Cyp2c19-sub | 0.331 |
| Cl | 4.993 |
| T12 | 0.051 |
| H-ht | 0.669 |
| Dili | 0.971 |
| Roa | 0.305 |
| Fdamdd | 0.913 |
| Skinsen | 0.048 |
| Ec | 0.003 |
| Ei | 0.024 |
| Respiratory | 0.473 |
| Bcf | 3.273 |
| Igc50 | 5.224 |
| Lc50 | 6.825 |
| Lc50dm | 5.91 |
| Nr-ar | 0.041 |
| Nr-ar-lbd | 0.05 |
| Nr-ahr | 0.944 |
| Nr-aromatase | 0.914 |
| Nr-er | 0.853 |
| Nr-er-lbd | 0.435 |
| Nr-ppar-gamma | 0.927 |
| Sr-are | 0.952 |
| Sr-atad5 | 0.621 |
| Sr-hse | 0.573 |
| Sr-mmp | 0.968 |
| Sr-p53 | 0.956 |
| Vol | 438.739 |
| Dense | 1.019 |
| Flex | 27 |
| Nstereo | 0.148 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.337 |
| Fsp3 | 2.311 |
| Mce-18 | 0.12 |
| Natural product-likeness | 58 |
| Alarm nmr | -1.56 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |