| General Information | |
|---|---|
| ZINC ID | ZINC000035079279 |
| Molecular Weight (Da) | 423 |
| SMILES | C[C@H](NC(=O)C(C)(C)Oc1ccccn1)[C@@H](Cc1ccc(Cl)cc1)c1ccccc1 |
| Molecular Formula | C25Cl1N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.445 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 5.815 |
| Activity (Ki) in nM | 1.8197 |
| Polar Surface Area (PSA) | 51.22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.038 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.28 |
| Ilogp | 3.6 |
| Xlogp3 | 5.86 |
| Wlogp | 5.42 |
| Mlogp | 4.06 |
| Silicos-it log p | 5.74 |
| Consensus log p | 4.94 |
| Esol log s | -6 |
| Esol solubility (mg/ml) | 0.000419 |
| Esol solubility (mol/l) | 0.00000099 |
| Esol class | Poorly sol |
| Ali log s | -6.71 |
| Ali solubility (mg/ml) | 0.0000829 |
| Ali solubility (mol/l) | 0.00000019 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.03 |
| Silicos-it solubility (mg/ml) | 0.00000039 |
| Silicos-it solubility (mol/l) | 9.35E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.72 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.891 |
| Logd | 4.008 |
| Logp | 5.591 |
| F (20%) | 0.606 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 98.63% |
| Vdss | 2.067 |
| Fu | 1.08% |
| Cyp1a2-inh | 0.632 |
| Cyp1a2-sub | 0.809 |
| Cyp2c19-inh | 0.931 |
| Cyp2c19-sub | 0.177 |
| Cl | 4.015 |
| T12 | 0.043 |
| H-ht | 0.912 |
| Dili | 0.966 |
| Roa | 0.253 |
| Fdamdd | 0.49 |
| Skinsen | 0.044 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.222 |
| Bcf | 1.011 |
| Igc50 | 3.656 |
| Lc50 | 4.457 |
| Lc50dm | 4.333 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.009 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.553 |
| Nr-er-lbd | 0.036 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.074 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.471 |
| Sr-p53 | 0.005 |
| Vol | 443.707 |
| Dense | 0.951 |
| Flex | 0.474 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.527 |
| Synth | 3.049 |
| Fsp3 | 0.28 |
| Mce-18 | 38 |
| Natural product-likeness | -0.797 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |