| General Information | |
|---|---|
| ZINC ID | ZINC000035790247 |
| Molecular Weight (Da) | 346 |
| SMILES | CC1(C)C(C(=O)c2cn(CCc3ccncc3)c3ccccc23)C1(C)C |
| Molecular Formula | C23N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.982 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 4.27 |
| Activity (Ki) in nM | 30.903 |
| Polar Surface Area (PSA) | 34.89 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.131 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.39 |
| Ilogp | 3.48 |
| Xlogp3 | 4.62 |
| Wlogp | 5.14 |
| Mlogp | 3.28 |
| Silicos-it log p | 5.26 |
| Consensus log p | 4.36 |
| Esol log s | -5 |
| Esol solubility (mg/ml) | 0.0035 |
| Esol solubility (mol/l) | 0.0000101 |
| Esol class | Moderately |
| Ali log s | -5.08 |
| Ali solubility (mg/ml) | 0.00289 |
| Ali solubility (mol/l) | 0.00000835 |
| Ali class | Moderately |
| Silicos-it logsw | -7.45 |
| Silicos-it solubility (mg/ml) | 0.0000123 |
| Silicos-it solubility (mol/l) | 3.56E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.13 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.72 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.328 |
| Logd | 4.135 |
| Logp | 4.902 |
| F (20%) | 0.449 |
| F (30%) | 0.024 |
| Mdck | 2.59E-05 |
| Ppb | 0.9295 |
| Vdss | 2.769 |
| Fu | 0.0577 |
| Cyp1a2-inh | 0.305 |
| Cyp1a2-sub | 0.585 |
| Cyp2c19-inh | 0.915 |
| Cyp2c19-sub | 0.366 |
| Cl | 3.839 |
| T12 | 0.064 |
| H-ht | 0.182 |
| Dili | 0.941 |
| Roa | 0.616 |
| Fdamdd | 0.913 |
| Skinsen | 0.32 |
| Ec | 0.003 |
| Ei | 0.107 |
| Respiratory | 0.954 |
| Bcf | 2.494 |
| Igc50 | 4.887 |
| Lc50 | 6.504 |
| Lc50dm | 6.438 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.514 |
| Nr-aromatase | 0.959 |
| Nr-er | 0.163 |
| Nr-er-lbd | 0.674 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.579 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.838 |
| Sr-mmp | 0.553 |
| Sr-p53 | 0.026 |
| Vol | 381.83 |
| Dense | 0.907 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.599 |
| Synth | 2.461 |
| Fsp3 | 0.391 |
| Mce-18 | 54.688 |
| Natural product-likeness | -0.65 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |