| General Information | |
|---|---|
| ZINC ID | ZINC000035941771 |
| Molecular Weight (Da) | 331 |
| SMILES | CC1(C)C(C(=O)c2cn(Cc3ccccc3)c3ccccc23)C1(C)C |
| Molecular Formula | C23N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.384 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 5.099 |
| Activity (Ki) in nM | 8.128 |
| Polar Surface Area (PSA) | 22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.20694565 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.35 |
| Ilogp | 3.56 |
| Xlogp3 | 5.4 |
| Wlogp | 5.55 |
| Mlogp | 4.16 |
| Silicos-it log p | 5.45 |
| Consensus log p | 4.82 |
| Esol log s | -5.48 |
| Esol solubility (mg/ml) | 0.00111 |
| Esol solubility (mol/l) | 0.00000333 |
| Esol class | Moderately |
| Ali log s | -5.62 |
| Ali solubility (mg/ml) | 0.000801 |
| Ali solubility (mol/l) | 0.00000242 |
| Ali class | Moderately |
| Silicos-it logsw | -7.43 |
| Silicos-it solubility (mg/ml) | 0.0000124 |
| Silicos-it solubility (mol/l) | 3.75E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.49 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.61 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.937 |
| Logd | 4.519 |
| Logp | 5.644 |
| F (20%) | 0.921 |
| F (30%) | 0.035 |
| Mdck | 1.64E-05 |
| Ppb | 0.9772 |
| Vdss | 0.81 |
| Fu | 0.0129 |
| Cyp1a2-inh | 0.126 |
| Cyp1a2-sub | 0.567 |
| Cyp2c19-inh | 0.841 |
| Cyp2c19-sub | 0.351 |
| Cl | 4.257 |
| T12 | 0.028 |
| H-ht | 0.077 |
| Dili | 0.857 |
| Roa | 0.352 |
| Fdamdd | 0.885 |
| Skinsen | 0.063 |
| Ec | 0.003 |
| Ei | 0.544 |
| Respiratory | 0.8 |
| Bcf | 2.656 |
| Igc50 | 5.044 |
| Lc50 | 6.437 |
| Lc50dm | 6.664 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.18 |
| Nr-aromatase | 0.891 |
| Nr-er | 0.615 |
| Nr-er-lbd | 0.226 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.269 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.437 |
| Sr-mmp | 0.739 |
| Sr-p53 | 0.007 |
| Vol | 370.834 |
| Dense | 0.893 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.574 |
| Synth | 2.211 |
| Fsp3 | 0.348 |
| Mce-18 | 54.839 |
| Natural product-likeness | -0.604 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |