| General Information | |
|---|---|
| ZINC ID | ZINC000036294822 |
| Molecular Weight (Da) | 491 |
| SMILES | C[C@@H](NC(=O)C(C)(C)Oc1ccc(Cl)cc1)[C@@H](Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| Molecular Formula | C26Cl3N1O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.898 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| LogP | 7.752 |
| Activity (Ki) in nM | 1096.478 |
| Polar Surface Area (PSA) | 38.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.019 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.35 |
| Xlogp3 | 7.85 |
| Wlogp | 7.34 |
| Mlogp | 6.02 |
| Silicos-it log p | 7.61 |
| Consensus log p | 6.63 |
| Esol log s | -7.65 |
| Esol solubility (mg/ml) | 0.000011 |
| Esol solubility (mol/l) | 2.23E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.5 |
| Ali solubility (mg/ml) | 0.00000154 |
| Ali solubility (mol/l) | 3.15E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.56 |
| Silicos-it solubility (mg/ml) | 1.34E-08 |
| Silicos-it solubility (mol/l) | 2.73E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.72 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.51 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.109 |
| Logd | 4.726 |
| Logp | 7.131 |
| F (20%) | 0.007 |
| F (30%) | 0.35 |
| Mdck | 4.38E-06 |
| Ppb | 1.0072 |
| Vdss | 1.289 |
| Fu | 0.0178 |
| Cyp1a2-inh | 0.376 |
| Cyp1a2-sub | 0.865 |
| Cyp2c19-inh | 0.856 |
| Cyp2c19-sub | 0.101 |
| Cl | 4.32 |
| T12 | 0.013 |
| H-ht | 0.568 |
| Dili | 0.903 |
| Roa | 0.133 |
| Fdamdd | 0.608 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.075 |
| Bcf | 3.15 |
| Igc50 | 4.804 |
| Lc50 | 6.03 |
| Lc50dm | 6.317 |
| Nr-ar | 0.141 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.055 |
| Nr-er | 0.448 |
| Nr-er-lbd | 0.034 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.146 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.013 |
| Sr-mmp | 0.723 |
| Sr-p53 | 0.247 |
| Vol | 480.429 |
| Dense | 1.018 |
| Flex | 0.474 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.359 |
| Synth | 2.962 |
| Fsp3 | 0.269 |
| Mce-18 | 42 |
| Natural product-likeness | -0.472 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |