| General Information | |
|---|---|
| ZINC ID | ZINC000036294928 |
| Molecular Weight (Da) | 434 |
| SMILES | CCCCCCCC(C)(C)/C=CC/C=CC/C=CC/C=CCC[C@@H](C)C(=O)NCCF |
| Molecular Formula | C28F1N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.674 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| LogP | 8.707 |
| Activity (Ki) in nM | 14.1254 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.862 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.68 |
| Ilogp | 3.67 |
| Xlogp3 | 6.69 |
| Wlogp | 8.69 |
| Mlogp | 5.46 |
| Silicos-it log p | 6.74 |
| Consensus log p | 5.83 |
| Esol log s | -6.62 |
| Esol solubility (mg/ml) | 0.000106 |
| Esol solubility (mol/l) | 0.00000024 |
| Esol class | Poorly sol |
| Ali log s | -7.3 |
| Ali solubility (mg/ml) | 0.0000221 |
| Ali solubility (mol/l) | 5.03E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.66 |
| Silicos-it solubility (mg/ml) | 9.54E-08 |
| Silicos-it solubility (mol/l) | 2.17E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.23 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.531 |
| Logd | 4.886 |
| Logp | 4.952 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 100.52% |
| Vdss | 3.023 |
| Fu | 1.02% |
| Cyp1a2-inh | 0.106 |
| Cyp1a2-sub | 0.92 |
| Cyp2c19-inh | 0.341 |
| Cyp2c19-sub | 0.496 |
| Cl | 4.199 |
| T12 | 0.922 |
| H-ht | 0.318 |
| Dili | 0.023 |
| Roa | 0.038 |
| Fdamdd | 0.625 |
| Skinsen | 0.935 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.963 |
| Bcf | 1.301 |
| Igc50 | 5.403 |
| Lc50 | 3.039 |
| Lc50dm | 5.325 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.001 |
| Nr-aromatase | 0.147 |
| Nr-er | 0.096 |
| Nr-er-lbd | 0.027 |
| Nr-ppar-gamma | 0.419 |
| Sr-are | 0.721 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.952 |
| Sr-mmp | 0.681 |
| Sr-p53 | 0.036 |
| Vol | 505.516 |
| Dense | 0.857 |
| Flex | 4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.161 |
| Synth | 3.725 |
| Fsp3 | 0.679 |
| Mce-18 | 5 |
| Natural product-likeness | 0.663 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |