| General Information | |
|---|---|
| ZINC ID | ZINC000038248788 |
| Molecular Weight (Da) | 352 |
| SMILES | CC1(C)C(C(=O)c2cn(CCc3cccs3)c3ccccc23)C1(C)C |
| Molecular Formula | C22N1O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.965 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 4.86 |
| Activity (Ki) in nM | 2.754 |
| Polar Surface Area (PSA) | 50.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11038005 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.41 |
| Ilogp | 3.88 |
| Xlogp3 | 5.41 |
| Wlogp | 5.81 |
| Mlogp | 3.98 |
| Silicos-it log p | 6.45 |
| Consensus log p | 5.11 |
| Esol log s | -5.51 |
| Esol solubility (mg/ml) | 0.00108 |
| Esol solubility (mol/l) | 0.00000308 |
| Esol class | Moderately |
| Ali log s | -6.22 |
| Ali solubility (mg/ml) | 0.000212 |
| Ali solubility (mol/l) | 0.0000006 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.09 |
| Silicos-it solubility (mg/ml) | 0.0000288 |
| Silicos-it solubility (mol/l) | 8.18E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.6 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.836 |
| Logd | 4.497 |
| Logp | 5.668 |
| F (20%) | 0.489 |
| F (30%) | 0.046 |
| Mdck | 1.58E-05 |
| Ppb | 0.98 |
| Vdss | 1.125 |
| Fu | 0.0123 |
| Cyp1a2-inh | 0.186 |
| Cyp1a2-sub | 0.862 |
| Cyp2c19-inh | 0.815 |
| Cyp2c19-sub | 0.305 |
| Cl | 3.476 |
| T12 | 0.019 |
| H-ht | 0.273 |
| Dili | 0.809 |
| Roa | 0.172 |
| Fdamdd | 0.889 |
| Skinsen | 0.048 |
| Ec | 0.003 |
| Ei | 0.407 |
| Respiratory | 0.895 |
| Bcf | 2.367 |
| Igc50 | 5.007 |
| Lc50 | 6.798 |
| Lc50dm | 6.428 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.129 |
| Nr-aromatase | 0.885 |
| Nr-er | 0.828 |
| Nr-er-lbd | 0.687 |
| Nr-ppar-gamma | 0.014 |
| Sr-are | 0.576 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.513 |
| Sr-mmp | 0.739 |
| Sr-p53 | 0.016 |
| Vol | 374.683 |
| Dense | 0.937 |
| Flex | 0.263 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 4 |
| Qed | 0.532 |
| Synth | 2.524 |
| Fsp3 | 0.409 |
| Mce-18 | 54.839 |
| Natural product-likeness | -1.248 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |