| General Information | |
|---|---|
| ZINC ID | ZINC000038430588 |
| Molecular Weight (Da) | 474 |
| SMILES | CC(C)(C)C(=O)c1oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc2c1N |
| Molecular Formula | C24Cl3N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.945 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 7.642 |
| Activity (Ki) in nM | 436.516 |
| Polar Surface Area (PSA) | 69.12 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.038 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.24 |
| Xlogp3 | 8.05 |
| Wlogp | 7.94 |
| Mlogp | 4.51 |
| Silicos-it log p | 7.37 |
| Consensus log p | 6.42 |
| Esol log s | -8.09 |
| Esol solubility (mg/ml) | 0.00000388 |
| Esol solubility (mol/l) | 8.20E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.36 |
| Ali solubility (mg/ml) | 0.0000002 |
| Ali solubility (mol/l) | 4.40E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.45 |
| Silicos-it solubility (mg/ml) | 1.69E-08 |
| Silicos-it solubility (mol/l) | 3.57E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.47 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.961 |
| Logd | 5.076 |
| Logp | 7.083 |
| F (20%) | 0.002 |
| F (30%) | 0.005 |
| Mdck | 7.57E-06 |
| Ppb | 1.0184 |
| Vdss | 1.148 |
| Fu | 0.0086 |
| Cyp1a2-inh | 0.871 |
| Cyp1a2-sub | 0.544 |
| Cyp2c19-inh | 0.818 |
| Cyp2c19-sub | 0.059 |
| Cl | 3.305 |
| T12 | 0.014 |
| H-ht | 0.801 |
| Dili | 0.982 |
| Roa | 0.412 |
| Fdamdd | 0.862 |
| Skinsen | 0.041 |
| Ec | 0.003 |
| Ei | 0.078 |
| Respiratory | 0.377 |
| Bcf | 3.476 |
| Igc50 | 5.406 |
| Lc50 | 7.307 |
| Lc50dm | 6.516 |
| Nr-ar | 0.025 |
| Nr-ar-lbd | 0.19 |
| Nr-ahr | 0.973 |
| Nr-aromatase | 0.951 |
| Nr-er | 0.864 |
| Nr-er-lbd | 0.734 |
| Nr-ppar-gamma | 0.888 |
| Sr-are | 0.963 |
| Sr-atad5 | 0.678 |
| Sr-hse | 0.828 |
| Sr-mmp | 0.951 |
| Sr-p53 | 0.941 |
| Vol | 445.64 |
| Dense | 1.059 |
| Flex | 0.174 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 5 |
| Surechembl | 0 |
| Nonbiodegradable | 4 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.307 |
| Synth | 2.658 |
| Fsp3 | 0.167 |
| Mce-18 | 27 |
| Natural product-likeness | -0.621 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |