| General Information | |
|---|---|
| ZINC ID | ZINC000040379630 |
| Molecular Weight (Da) | 476 |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)nc(Cc1ccc(OC3CCCCC3)cc1)n2CCC(C)C |
| Molecular Formula | C30N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.928 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| LogP | 7 |
| Activity (Ki) in nM | 524.807 |
| Polar Surface Area (PSA) | 47.36 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04840064 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.53 |
| Ilogp | 5.22 |
| Xlogp3 | 6.99 |
| Wlogp | 6.87 |
| Mlogp | 4.63 |
| Silicos-it log p | 6.37 |
| Consensus log p | 6.01 |
| Esol log s | -6.78 |
| Esol solubility (mg/ml) | 7.82E-05 |
| Esol solubility (mol/l) | 1.64E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.8 |
| Ali solubility (mg/ml) | 7.55E-06 |
| Ali solubility (mol/l) | 1.59E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.53 |
| Silicos-it solubility (mg/ml) | 1.39E-06 |
| Silicos-it solubility (mol/l) | 2.92E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.24 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.732 |
| Logd | 4.777 |
| Logp | 6.499 |
| F (20%) | 0.221 |
| F (30%) | 0.714 |
| Mdck | 1.26E-05 |
| Ppb | 0.9745 |
| Vdss | 1.007 |
| Fu | 0.0065 |
| Cyp1a2-inh | 0.092 |
| Cyp1a2-sub | 0.743 |
| Cyp2c19-inh | 0.88 |
| Cyp2c19-sub | 0.071 |
| Cl | 5.83 |
| T12 | 0.173 |
| H-ht | 0.742 |
| Dili | 0.826 |
| Roa | 0.628 |
| Fdamdd | 0.831 |
| Skinsen | 0.077 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.832 |
| Bcf | 1.997 |
| Igc50 | 5.209 |
| Lc50 | 5.989 |
| Lc50dm | 6.214 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.405 |
| Nr-aromatase | 0.968 |
| Nr-er | 0.42 |
| Nr-er-lbd | 0.23 |
| Nr-ppar-gamma | 0.135 |
| Sr-are | 0.692 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.733 |
| Sr-mmp | 0.838 |
| Sr-p53 | 0.705 |
| Vol | 522.689 |
| Dense | 0.909 |
| Flex | 23 |
| Nstereo | 0.478 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.321 |
| Fsp3 | 2.46 |
| Mce-18 | 0.533 |
| Natural product-likeness | 52 |
| Alarm nmr | -1.206 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |