| General Information | |
|---|---|
| ZINC ID | ZINC000040380649 |
| Molecular Weight (Da) | 355 |
| SMILES | CCCCCCN1C(=O)/C(=NNC(=O)C2CCCCC2)c2ccccc21 |
| Molecular Formula | C21N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.716 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 4.801 |
| Activity (Ki) in nM | 79.433 |
| Polar Surface Area (PSA) | 61.77 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94347828 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.57 |
| Ilogp | 3.33 |
| Xlogp3 | 5.65 |
| Wlogp | 3.63 |
| Mlogp | 3.02 |
| Silicos-it log p | 4.31 |
| Consensus log p | 3.99 |
| Esol log s | -5.25 |
| Esol solubility (mg/ml) | 2.02E-03 |
| Esol solubility (mol/l) | 5.67E-06 |
| Esol class | Moderately |
| Ali log s | -6.71 |
| Ali solubility (mg/ml) | 6.91E-05 |
| Ali solubility (mol/l) | 1.94E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.01 |
| Silicos-it solubility (mg/ml) | 3.46E-04 |
| Silicos-it solubility (mol/l) | 9.73E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.46 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.54 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.629 |
| Logd | 4.538 |
| Logp | 5.692 |
| F (20%) | 0.962 |
| F (30%) | 0.796 |
| Mdck | 1.96E-05 |
| Ppb | 0.9951 |
| Vdss | 3.034 |
| Fu | 0.0133 |
| Cyp1a2-inh | 0.404 |
| Cyp1a2-sub | 0.654 |
| Cyp2c19-inh | 0.811 |
| Cyp2c19-sub | 0.612 |
| Cl | 1.64 |
| T12 | 0.11 |
| H-ht | 0.23 |
| Dili | 0.531 |
| Roa | 0.134 |
| Fdamdd | 0.36 |
| Skinsen | 0.609 |
| Ec | 0.003 |
| Ei | 0.035 |
| Respiratory | 0.858 |
| Bcf | 1.851 |
| Igc50 | 5.015 |
| Lc50 | 5.622 |
| Lc50dm | 4.791 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.957 |
| Nr-aromatase | 0.137 |
| Nr-er | 0.674 |
| Nr-er-lbd | 0.019 |
| Nr-ppar-gamma | 0.674 |
| Sr-are | 0.738 |
| Sr-atad5 | 0.61 |
| Sr-hse | 0.539 |
| Sr-mmp | 0.697 |
| Sr-p53 | 0.172 |
| Vol | 380.855 |
| Dense | 0.933 |
| Flex | 18 |
| Nstereo | 0.444 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 3 |
| Synth | 0.48 |
| Fsp3 | 2.729 |
| Mce-18 | 0.571 |
| Natural product-likeness | 37.818 |
| Alarm nmr | -0.711 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |