| General Information | |
|---|---|
| ZINC ID | ZINC000040394389 |
| Molecular Weight (Da) | 310 |
| SMILES | COc1ccccc1Cc1cc2c(OC)ccc(C)c2oc1=O |
| Molecular Formula | C19O4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 87.425 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 4.439 |
| Activity (Ki) in nM | 3630.781 |
| Polar Surface Area (PSA) | 48.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.93725043 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.21 |
| Ilogp | 3.37 |
| Xlogp3 | 4.15 |
| Wlogp | 3.71 |
| Mlogp | 2.85 |
| Silicos-it log p | 4.93 |
| Consensus log p | 3.8 |
| Esol log s | -4.63 |
| Esol solubility (mg/ml) | 7.28E-03 |
| Esol solubility (mol/l) | 2.35E-05 |
| Esol class | Moderately |
| Ali log s | -4.88 |
| Ali solubility (mg/ml) | 4.09E-03 |
| Ali solubility (mol/l) | 1.32E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -7.16 |
| Silicos-it solubility (mg/ml) | 2.15E-05 |
| Silicos-it solubility (mol/l) | 6.92E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.25 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.32 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.76 |
| Logd | 3.603 |
| Logp | 3.724 |
| F (20%) | 0.003 |
| F (30%) | 0.259 |
| Mdck | 2.91E-05 |
| Ppb | 0.9854 |
| Vdss | 0.377 |
| Fu | 0.0285 |
| Cyp1a2-inh | 0.914 |
| Cyp1a2-sub | 0.953 |
| Cyp2c19-inh | 0.961 |
| Cyp2c19-sub | 0.74 |
| Cl | 8.855 |
| T12 | 0.455 |
| H-ht | 0.895 |
| Dili | 0.96 |
| Roa | 0.095 |
| Fdamdd | 0.113 |
| Skinsen | 0.102 |
| Ec | 0.003 |
| Ei | 0.07 |
| Respiratory | 0.127 |
| Bcf | 2.324 |
| Igc50 | 4.169 |
| Lc50 | 5.034 |
| Lc50dm | 4.865 |
| Nr-ar | 0.128 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.855 |
| Nr-aromatase | 0.705 |
| Nr-er | 0.257 |
| Nr-er-lbd | 0.04 |
| Nr-ppar-gamma | 0.142 |
| Sr-are | 0.342 |
| Sr-atad5 | 0.182 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.33 |
| Sr-p53 | 0.521 |
| Vol | 325.58 |
| Dense | 0.953 |
| Flex | 18 |
| Nstereo | 0.222 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.689 |
| Fsp3 | 2.177 |
| Mce-18 | 0.211 |
| Natural product-likeness | 17 |
| Alarm nmr | 0.072 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |