| General Information | |
|---|---|
| ZINC ID | ZINC000040405422 |
| Molecular Weight (Da) | 413 |
| SMILES | Fc1ccc(-c2noc(C3CCN(c4cnc5c(c4)CCCC5)CC3)n2)c(Cl)c1 |
| Molecular Formula | C22Cl1F1N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.198 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| LogP | 4.928 |
| Activity (Ki) in nM | 19.055 |
| Polar Surface Area (PSA) | 55.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95043879 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.41 |
| Ilogp | 4.03 |
| Xlogp3 | 5.08 |
| Wlogp | 5.23 |
| Mlogp | 4.17 |
| Silicos-it log p | 5.27 |
| Consensus log p | 4.75 |
| Esol log s | -5.84 |
| Esol solubility (mg/ml) | 0.000602 |
| Esol solubility (mol/l) | 0.00000146 |
| Esol class | Moderately |
| Ali log s | -5.98 |
| Ali solubility (mg/ml) | 0.000434 |
| Ali solubility (mol/l) | 0.00000105 |
| Ali class | Moderately |
| Silicos-it logsw | -7.94 |
| Silicos-it solubility (mg/ml) | 0.00000477 |
| Silicos-it solubility (mol/l) | 1.16E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.21 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.52 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.497 |
| Logd | 4.372 |
| Logp | 5.794 |
| F (20%) | 0.002 |
| F (30%) | 0.023 |
| Mdck | 1.49E-05 |
| Ppb | 0.9917 |
| Vdss | 3.272 |
| Fu | 0.0102 |
| Cyp1a2-inh | 0.501 |
| Cyp1a2-sub | 0.863 |
| Cyp2c19-inh | 0.762 |
| Cyp2c19-sub | 0.064 |
| Cl | 3.115 |
| T12 | 0.03 |
| H-ht | 0.987 |
| Dili | 0.963 |
| Roa | 0.937 |
| Fdamdd | 0.918 |
| Skinsen | 0.852 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.827 |
| Bcf | 2.744 |
| Igc50 | 4.746 |
| Lc50 | 5.106 |
| Lc50dm | 5.953 |
| Nr-ar | 0.064 |
| Nr-ar-lbd | 0.557 |
| Nr-ahr | 0.855 |
| Nr-aromatase | 0.842 |
| Nr-er | 0.348 |
| Nr-er-lbd | 0.042 |
| Nr-ppar-gamma | 0.774 |
| Sr-are | 0.82 |
| Sr-atad5 | 0.655 |
| Sr-hse | 0.512 |
| Sr-mmp | 0.377 |
| Sr-p53 | 0.888 |
| Vol | 399.25 |
| Dense | 1.032 |
| Flex | 0.107 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.592 |
| Synth | 2.592 |
| Fsp3 | 0.409 |
| Mce-18 | 64.516 |
| Natural product-likeness | -2.041 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |