| General Information | |
|---|---|
| ZINC ID | ZINC000040407155 |
| Molecular Weight (Da) | 360 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)N[C@@H]1C[C@H]1O |
| Molecular Formula | C23N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.202 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| LogP | 5.417 |
| Activity (Ki) in nM | 190.546 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.009 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.61 |
| Ilogp | 4.04 |
| Xlogp3 | 5.19 |
| Wlogp | 5.38 |
| Mlogp | 3.4 |
| Silicos-it log p | 4 |
| Consensus log p | 4.22 |
| Esol log s | -6.02 |
| Esol solubility (mg/ml) | 0.000446 |
| Esol solubility (mol/l) | 0.00000094 |
| Esol class | Poorly sol |
| Ali log s | -6.68 |
| Ali solubility (mg/ml) | 0.0000974 |
| Ali solubility (mol/l) | 0.0000002 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.47 |
| Silicos-it solubility (mg/ml) | 0.000016 |
| Silicos-it solubility (mol/l) | 0.00000003 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.48 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.5 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.01 |
| Logd | 2.556 |
| Logp | 1.962 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | 0.00011187 |
| Ppb | 0.9839 |
| Vdss | 1.257 |
| Fu | 0.0155 |
| Cyp1a2-inh | 0.176 |
| Cyp1a2-sub | 0.868 |
| Cyp2c19-inh | 0.475 |
| Cyp2c19-sub | 0.256 |
| Cl | 3.509 |
| T12 | 0.938 |
| H-ht | 0.271 |
| Dili | 0.022 |
| Roa | 0.004 |
| Fdamdd | 0.219 |
| Skinsen | 0.966 |
| Ec | 0.003 |
| Ei | 0.027 |
| Respiratory | 0.869 |
| Bcf | 1.209 |
| Igc50 | 4.935 |
| Lc50 | 2.618 |
| Lc50dm | 4.126 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.051 |
| Nr-er | 0.062 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.88 |
| Sr-are | 0.698 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.942 |
| Sr-mmp | 0.308 |
| Sr-p53 | 0.312 |
| Vol | 413.203 |
| Dense | 0.87 |
| Flex | 2 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.304 |
| Synth | 3.638 |
| Fsp3 | 0.609 |
| Mce-18 | 12.973 |
| Natural product-likeness | 0.697 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |