| General Information | |
|---|---|
| ZINC ID | ZINC000040424309 |
| Molecular Weight (Da) | 488 |
| SMILES | CN1C(c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2C2CC2)=NC(=O)C1(C)C |
| Molecular Formula | C24Cl3N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.133 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| LogP | 7.242 |
| Activity (Ki) in nM | 812.831 |
| Polar Surface Area (PSA) | 50.49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.883 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 4.15 |
| Xlogp3 | 6.39 |
| Wlogp | 5.55 |
| Mlogp | 5.41 |
| Silicos-it log p | 6.63 |
| Consensus log p | 5.63 |
| Esol log s | -7.02 |
| Esol solubility (mg/ml) | 0.0000467 |
| Esol solubility (mol/l) | 9.57E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.24 |
| Ali solubility (mg/ml) | 0.0000279 |
| Ali solubility (mol/l) | 5.72E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.97 |
| Silicos-it solubility (mg/ml) | 0.00000052 |
| Silicos-it solubility (mol/l) | 1.08E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.74 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.82 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.344 |
| Logd | 4.793 |
| Logp | 6.02 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | 1.01E-05 |
| Ppb | 0.9507 |
| Vdss | 0.58 |
| Fu | 0.0246 |
| Cyp1a2-inh | 0.126 |
| Cyp1a2-sub | 0.957 |
| Cyp2c19-inh | 0.843 |
| Cyp2c19-sub | 0.945 |
| Cl | 1.972 |
| T12 | 0.041 |
| H-ht | 0.327 |
| Dili | 0.942 |
| Roa | 0.871 |
| Fdamdd | 0.736 |
| Skinsen | 0.034 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.527 |
| Bcf | 3.81 |
| Igc50 | 5.089 |
| Lc50 | 6.981 |
| Lc50dm | 5.89 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.013 |
| Nr-ahr | 0.599 |
| Nr-aromatase | 0.964 |
| Nr-er | 0.84 |
| Nr-er-lbd | 0.452 |
| Nr-ppar-gamma | 0.472 |
| Sr-are | 0.862 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.092 |
| Sr-mmp | 0.937 |
| Sr-p53 | 0.944 |
| Vol | 452.924 |
| Dense | 1.073 |
| Flex | 0.154 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.429 |
| Synth | 2.925 |
| Fsp3 | 0.292 |
| Mce-18 | 70 |
| Natural product-likeness | -0.711 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |