| General Information | |
|---|---|
| ZINC ID | ZINC000040424409 |
| Molecular Weight (Da) | 427 |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CCc3cc(-c4ccccc4F)no3)ccc21 |
| Molecular Formula | C26F1N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.073 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 5.495 |
| Activity (Ki) in nM | 269.153 |
| Polar Surface Area (PSA) | 60.06 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04361724 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.15 |
| Ilogp | 3.6 |
| Xlogp3 | 4.95 |
| Wlogp | 6.41 |
| Mlogp | 3.99 |
| Silicos-it log p | 5.62 |
| Consensus log p | 4.91 |
| Esol log s | -5.7 |
| Esol solubility (mg/ml) | 8.49E-04 |
| Esol solubility (mol/l) | 1.99E-06 |
| Esol class | Moderately |
| Ali log s | -5.95 |
| Ali solubility (mg/ml) | 4.81E-04 |
| Ali solubility (mol/l) | 1.12E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -9.79 |
| Silicos-it solubility (mg/ml) | 6.98E-08 |
| Silicos-it solubility (mol/l) | 1.63E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.39 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.146 |
| Logd | 4.437 |
| Logp | 5.69 |
| F (20%) | 0.358 |
| F (30%) | 0.915 |
| Mdck | 8.55E-06 |
| Ppb | 0.9937 |
| Vdss | 2.041 |
| Fu | 0.0071 |
| Cyp1a2-inh | 0.931 |
| Cyp1a2-sub | 0.501 |
| Cyp2c19-inh | 0.935 |
| Cyp2c19-sub | 0.061 |
| Cl | 4.357 |
| T12 | 0.041 |
| H-ht | 0.984 |
| Dili | 0.949 |
| Roa | 0.428 |
| Fdamdd | 0.956 |
| Skinsen | 0.044 |
| Ec | 0.003 |
| Ei | 0.199 |
| Respiratory | 0.913 |
| Bcf | 2.211 |
| Igc50 | 5.081 |
| Lc50 | 6.716 |
| Lc50dm | 6.757 |
| Nr-ar | 0.208 |
| Nr-ar-lbd | 0.496 |
| Nr-ahr | 0.973 |
| Nr-aromatase | 0.446 |
| Nr-er | 0.825 |
| Nr-er-lbd | 0.04 |
| Nr-ppar-gamma | 0.884 |
| Sr-are | 0.904 |
| Sr-atad5 | 0.618 |
| Sr-hse | 0.108 |
| Sr-mmp | 0.907 |
| Sr-p53 | 0.868 |
| Vol | 440.471 |
| Dense | 0.97 |
| Flex | 27 |
| Nstereo | 0.259 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 2 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 1 |
| Qed | 2 |
| Synth | 0.352 |
| Fsp3 | 2.297 |
| Mce-18 | 0.154 |
| Natural product-likeness | 26 |
| Alarm nmr | -1.729 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |