| General Information | |
|---|---|
| ZINC ID | ZINC000040425433 |
| Molecular Weight (Da) | 448 |
| SMILES | O=C(CCc1nc(-c2ccc(F)cc2Cl)no1)Nc1ccc(C(F)(F)F)c(Cl)c1 |
| Molecular Formula | C18Cl2F4N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 98.193 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 4.867 |
| Activity (Ki) in nM | 25.119 |
| Polar Surface Area (PSA) | 68.02 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08589315 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.48 |
| Xlogp3 | 5.14 |
| Wlogp | 7.15 |
| Mlogp | 4.04 |
| Silicos-it log p | 6 |
| Consensus log p | 5.16 |
| Esol log s | -5.83 |
| Esol solubility (mg/ml) | 6.65E-04 |
| Esol solubility (mol/l) | 1.48E-06 |
| Esol class | Moderately |
| Ali log s | -6.31 |
| Ali solubility (mg/ml) | 2.18E-04 |
| Ali solubility (mol/l) | 4.86E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.98 |
| Silicos-it solubility (mg/ml) | 4.64E-07 |
| Silicos-it solubility (mol/l) | 1.04E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.38 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.11 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.933 |
| Logd | 4.041 |
| Logp | 4.853 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 1.09E-05 |
| Ppb | 1.0022 |
| Vdss | 3.147 |
| Fu | 0.0073 |
| Cyp1a2-inh | 0.949 |
| Cyp1a2-sub | 0.708 |
| Cyp2c19-inh | 0.901 |
| Cyp2c19-sub | 0.067 |
| Cl | 3.236 |
| T12 | 0.028 |
| H-ht | 0.95 |
| Dili | 0.979 |
| Roa | 0.524 |
| Fdamdd | 0.54 |
| Skinsen | 0.164 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.975 |
| Bcf | 2.205 |
| Igc50 | 4.326 |
| Lc50 | 5.287 |
| Lc50dm | 6.36 |
| Nr-ar | 0.59 |
| Nr-ar-lbd | 0.6 |
| Nr-ahr | 0.923 |
| Nr-aromatase | 0.151 |
| Nr-er | 0.422 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.763 |
| Sr-are | 0.888 |
| Sr-atad5 | 0.033 |
| Sr-hse | 0.023 |
| Sr-mmp | 0.587 |
| Sr-p53 | 0.767 |
| Vol | 375.75 |
| Dense | 1.19 |
| Flex | 18 |
| Nstereo | 0.389 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 3 |
| Qed | 1 |
| Synth | 0.503 |
| Fsp3 | 2.331 |
| Mce-18 | 0.167 |
| Natural product-likeness | 21 |
| Alarm nmr | -2.3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |