| General Information | |
|---|---|
| ZINC ID | ZINC000040428853 |
| Molecular Weight (Da) | 404 |
| SMILES | CC(C)(C)c1ncc(NC(=O)CCc2nc(-c3ccc(F)cc3Cl)no2)cn1 |
| Molecular Formula | C19Cl1F1N5O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 99.905 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 2.983 |
| Activity (Ki) in nM | 575.44 |
| Polar Surface Area (PSA) | 93.8 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.98122394 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.32 |
| Ilogp | 3.39 |
| Xlogp3 | 3.62 |
| Wlogp | 4.42 |
| Mlogp | 2.24 |
| Silicos-it log p | 4.5 |
| Consensus log p | 3.63 |
| Esol log s | -4.61 |
| Esol solubility (mg/ml) | 0.00987 |
| Esol solubility (mol/l) | 0.0000245 |
| Esol class | Moderately |
| Ali log s | -5.28 |
| Ali solubility (mg/ml) | 0.00213 |
| Ali solubility (mol/l) | 0.00000528 |
| Ali class | Moderately |
| Silicos-it logsw | -7.99 |
| Silicos-it solubility (mg/ml) | 0.00000413 |
| Silicos-it solubility (mol/l) | 1.02E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.19 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.655 |
| Logd | 3.351 |
| Logp | 3.557 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 98.14% |
| Vdss | 1.457 |
| Fu | 1.63% |
| Cyp1a2-inh | 0.771 |
| Cyp1a2-sub | 0.709 |
| Cyp2c19-inh | 0.788 |
| Cyp2c19-sub | 0.06 |
| Cl | 1.602 |
| T12 | 0.11 |
| H-ht | 0.851 |
| Dili | 0.982 |
| Roa | 0.551 |
| Fdamdd | 0.674 |
| Skinsen | 0.422 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.945 |
| Bcf | 1.709 |
| Igc50 | 2.792 |
| Lc50 | 3.301 |
| Lc50dm | 4.02 |
| Nr-ar | 0.555 |
| Nr-ar-lbd | 0.021 |
| Nr-ahr | 0.911 |
| Nr-aromatase | 0.031 |
| Nr-er | 0.295 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.578 |
| Sr-are | 0.721 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.022 |
| Sr-mmp | 0.348 |
| Sr-p53 | 0.178 |
| Vol | 381.626 |
| Dense | 1.056 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.686 |
| Synth | 2.49 |
| Fsp3 | 0.316 |
| Mce-18 | 20 |
| Natural product-likeness | -2.448 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |