| General Information | |
|---|---|
| ZINC ID | ZINC000040429308 |
| Molecular Weight (Da) | 504 |
| SMILES | CC(C)C(=O)NC1CCN(c2cnc(-c3ccc(C(F)(F)F)cc3)c(-c3ccncc3Cl)n2)CC1 |
| Molecular Formula | C25Cl1F3N5O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.663 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 4.877 |
| Activity (Ki) in nM | 4897.788 |
| Polar Surface Area (PSA) | 71.01 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.982 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.36 |
| Ilogp | 3.88 |
| Xlogp3 | 4.92 |
| Wlogp | 6.39 |
| Mlogp | 2.98 |
| Silicos-it log p | 5.46 |
| Consensus log p | 4.73 |
| Esol log s | -5.98 |
| Esol solubility (mg/ml) | 0.000524 |
| Esol solubility (mol/l) | 0.00000104 |
| Esol class | Moderately |
| Ali log s | -6.15 |
| Ali solubility (mg/ml) | 0.000359 |
| Ali solubility (mol/l) | 0.00000071 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.95 |
| Silicos-it solubility (mg/ml) | 0.00000056 |
| Silicos-it solubility (mol/l) | 1.12E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.88 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.414 |
| Logd | 4.291 |
| Logp | 5.129 |
| F (20%) | 0.002 |
| F (30%) | 0.031 |
| Mdck | 2.27E-05 |
| Ppb | 0.9695 |
| Vdss | 3.305 |
| Fu | 0.0364 |
| Cyp1a2-inh | 0.7 |
| Cyp1a2-sub | 0.602 |
| Cyp2c19-inh | 0.854 |
| Cyp2c19-sub | 0.103 |
| Cl | 5.667 |
| T12 | 0.019 |
| H-ht | 0.985 |
| Dili | 0.975 |
| Roa | 0.965 |
| Fdamdd | 0.603 |
| Skinsen | 0.048 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.597 |
| Bcf | 1.99 |
| Igc50 | 3.966 |
| Lc50 | 5.612 |
| Lc50dm | 5.948 |
| Nr-ar | 0.057 |
| Nr-ar-lbd | 0.125 |
| Nr-ahr | 0.484 |
| Nr-aromatase | 0.966 |
| Nr-er | 0.318 |
| Nr-er-lbd | 0.415 |
| Nr-ppar-gamma | 0.343 |
| Sr-are | 0.851 |
| Sr-atad5 | 0.101 |
| Sr-hse | 0.754 |
| Sr-mmp | 0.44 |
| Sr-p53 | 0.928 |
| Vol | 477.553 |
| Dense | 1.054 |
| Flex | 0.28 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 4 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 0 |
| Qed | 0.489 |
| Synth | 2.68 |
| Fsp3 | 0.36 |
| Mce-18 | 59.647 |
| Natural product-likeness | -1.338 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Rejected |