| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040431001 |
| Molecular Weight (Da) | 380 |
| SMILES | CCCCCn1cc(C(=O)N[C@H](C)c2ccccc2)c(=O)c2ccc(F)cc21 |
| Molecular Formula | C23F1N2O2 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040431001 |
| Molecular Weight (Da) | 380 |
| SMILES | CCCCCn1cc(C(=O)N[C@H](C)c2ccccc2)c(=O)c2ccc(F)cc21 |
| Molecular Formula | C23F1N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040431001 |
| Molar Refractivity | 106.503 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| LogP | 5.276 |
| Activity (Ki) in nM | 10.715 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040431001 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.044 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.3 |
| Ilogp | 3.36 |
| Xlogp3 | 5.52 |
| Wlogp | 4.92 |
| Mlogp | 3.37 |
| Silicos-it log p | 5.27 |
| Consensus log p | 4.49 |
| Esol log s | -5.57 |
| Esol solubility (mg/ml) | 0.00102 |
| Esol solubility (mol/l) | 0.00000268 |
| Esol class | Moderately |
| Ali log s | -6.35 |
| Ali solubility (mg/ml) | 0.000169 |
| Ali solubility (mol/l) | 0.00000044 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.96 |
| Silicos-it solubility (mg/ml) | 0.00000418 |
| Silicos-it solubility (mol/l) | 0.00000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.7 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.28 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.655 |
| Logd | 3.738 |
| Logp | 4.865 |
| F (20%) | 0.003 |
| F (30%) | 0.117 |
| Mdck | 1.42E-05 |
| Ppb | 0.9607 |
| Vdss | 1.605 |
| Fu | 0.0236 |
| Cyp1a2-inh | 0.496 |
| Cyp1a2-sub | 0.452 |
| Cyp2c19-inh | 0.758 |
| Cyp2c19-sub | 0.077 |
| Cl | 2.501 |
| T12 | 0.031 |
| H-ht | 0.727 |
| Dili | 0.856 |
| Roa | 0.028 |
| Fdamdd | 0.932 |
| Skinsen | 0.196 |
| Ec | 0.003 |
| Ei | 0.026 |
| Respiratory | 0.187 |
| Bcf | 1.256 |
| Igc50 | 4.689 |
| Lc50 | 5.503 |
| Lc50dm | 6.267 |
| Nr-ar | 0.58 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.469 |
| Nr-aromatase | 0.855 |
| Nr-er | 0.192 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.368 |
| Sr-are | 0.469 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.154 |
| Sr-mmp | 0.441 |
| Sr-p53 | 0.096 |
| Vol | 402.608 |
| Dense | 0.944 |
| Flex | 0.421 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.597 |
| Synth | 2.529 |
| Fsp3 | 0.304 |
| Mce-18 | 36 |
| Natural product-likeness | -1.349 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |