| General Information | |
|---|---|
| ZINC ID | ZINC000040846624 |
| Molecular Weight (Da) | 349 |
| SMILES | CCCCCCN1C(=O)/C(=NNC(=O)c2ccccc2)c2ccccc21 |
| Molecular Formula | C21N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.687 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 4.339 |
| Activity (Ki) in nM | 870.964 |
| Polar Surface Area (PSA) | 61.77 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.02996039 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.29 |
| Ilogp | 2.7 |
| Xlogp3 | 5.23 |
| Wlogp | 3.37 |
| Mlogp | 3.06 |
| Silicos-it log p | 4.21 |
| Consensus log p | 3.71 |
| Esol log s | -5.11 |
| Esol solubility (mg/ml) | 0.00268 |
| Esol solubility (mol/l) | 0.00000768 |
| Esol class | Moderately |
| Ali log s | -6.28 |
| Ali solubility (mg/ml) | 0.000185 |
| Ali solubility (mol/l) | 0.00000053 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.1 |
| Silicos-it solubility (mg/ml) | 0.000028 |
| Silicos-it solubility (mol/l) | 8.02E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.72 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.24 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.295 |
| Logd | 4.287 |
| Logp | 5.181 |
| F (20%) | 0.021 |
| F (30%) | 0.436 |
| Mdck | - |
| Ppb | 99.95% |
| Vdss | 1.079 |
| Fu | 1.29% |
| Cyp1a2-inh | 0.817 |
| Cyp1a2-sub | 0.244 |
| Cyp2c19-inh | 0.901 |
| Cyp2c19-sub | 0.248 |
| Cl | 1.382 |
| T12 | 0.178 |
| H-ht | 0.262 |
| Dili | 0.77 |
| Roa | 0.064 |
| Fdamdd | 0.15 |
| Skinsen | 0.27 |
| Ec | 0.003 |
| Ei | 0.08 |
| Respiratory | 0.792 |
| Bcf | 1.125 |
| Igc50 | 4.709 |
| Lc50 | 5.596 |
| Lc50dm | 4.473 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.974 |
| Nr-aromatase | 0.024 |
| Nr-er | 0.797 |
| Nr-er-lbd | 0.082 |
| Nr-ppar-gamma | 0.173 |
| Sr-are | 0.734 |
| Sr-atad5 | 0.78 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.705 |
| Sr-p53 | 0.044 |
| Vol | 372.945 |
| Dense | 0.936 |
| Flex | 0.444 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.429 |
| Synth | 2.458 |
| Fsp3 | 0.286 |
| Mce-18 | 16 |
| Natural product-likeness | -0.791 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |