| General Information | |
|---|---|
| ZINC ID | ZINC000040866336 |
| Molecular Weight (Da) | 407 |
| SMILES | CCOc1ccc(Cc2nc3cc(N(C)C(=O)N(C)C)ccc3n2CC2CC2)cc1 |
| Molecular Formula | C24N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.279 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| LogP | 5.291 |
| Activity (Ki) in nM | 36.308 |
| Polar Surface Area (PSA) | 50.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.79419893 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.42 |
| Ilogp | 3.85 |
| Xlogp3 | 3.78 |
| Wlogp | 4.49 |
| Mlogp | 3.42 |
| Silicos-it log p | 3.37 |
| Consensus log p | 3.78 |
| Esol log s | -4.52 |
| Esol solubility (mg/ml) | 1.23E-02 |
| Esol solubility (mol/l) | 3.04E-05 |
| Esol class | Moderately |
| Ali log s | -4.54 |
| Ali solubility (mg/ml) | 1.18E-02 |
| Ali solubility (mol/l) | 2.91E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.24 |
| Silicos-it solubility (mg/ml) | 2.32E-04 |
| Silicos-it solubility (mol/l) | 5.70E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.1 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.11 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.372 |
| Logd | 3.287 |
| Logp | 4.079 |
| F (20%) | 0.007 |
| F (30%) | 0.754 |
| Mdck | 2.37E-05 |
| Ppb | 0.9298 |
| Vdss | 0.87 |
| Fu | 0.0412 |
| Cyp1a2-inh | 0.379 |
| Cyp1a2-sub | 0.912 |
| Cyp2c19-inh | 0.933 |
| Cyp2c19-sub | 0.937 |
| Cl | 7.818 |
| T12 | 0.495 |
| H-ht | 0.699 |
| Dili | 0.78 |
| Roa | 0.234 |
| Fdamdd | 0.898 |
| Skinsen | 0.077 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.946 |
| Bcf | 2.48 |
| Igc50 | 4.067 |
| Lc50 | 5.802 |
| Lc50dm | 5.203 |
| Nr-ar | 0.07 |
| Nr-ar-lbd | 0.062 |
| Nr-ahr | 0.3 |
| Nr-aromatase | 0.87 |
| Nr-er | 0.61 |
| Nr-er-lbd | 0.093 |
| Nr-ppar-gamma | 0.05 |
| Sr-are | 0.776 |
| Sr-atad5 | 0.025 |
| Sr-hse | 0.478 |
| Sr-mmp | 0.791 |
| Sr-p53 | 0.901 |
| Vol | 429.91 |
| Dense | 0.945 |
| Flex | 20 |
| Nstereo | 0.45 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.578 |
| Fsp3 | 2.489 |
| Mce-18 | 0.417 |
| Natural product-likeness | 50.059 |
| Alarm nmr | -1.434 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |