| General Information | |
|---|---|
| ZINC ID | ZINC000040872422 |
| Molecular Weight (Da) | 428 |
| SMILES | C[C@H](CO)NC(=O)CCC/C=CC/C=CC/C=CC/C=CCCCCCc1ccco1 |
| Molecular Formula | C27N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.505 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| LogP | 6.09 |
| Activity (Ki) in nM | 3235.937 |
| Polar Surface Area (PSA) | 62.47 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.72196149 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 5 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.86 |
| Xlogp3 | 5.92 |
| Wlogp | 6.44 |
| Mlogp | 4.83 |
| Silicos-it log p | 6.16 |
| Consensus log p | 5.54 |
| Esol log s | -6.95 |
| Esol solubility (mg/ml) | 0.0000546 |
| Esol solubility (mol/l) | 0.00000011 |
| Esol class | Poorly sol |
| Ali log s | -7.16 |
| Ali solubility (mg/ml) | 0.0000337 |
| Ali solubility (mol/l) | 6.97E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.65 |
| Silicos-it solubility (mg/ml) | 1.08E-08 |
| Silicos-it solubility (mol/l) | 2.23E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.04 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.96 |
| Logd | 2.83 |
| Logp | 2.291 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | 9.67E-05 |
| Ppb | 0.9981 |
| Vdss | 3.052 |
| Fu | 0.0097 |
| Cyp1a2-inh | 0.262 |
| Cyp1a2-sub | 0.854 |
| Cyp2c19-inh | 0.522 |
| Cyp2c19-sub | 0.071 |
| Cl | 3.914 |
| T12 | 0.948 |
| H-ht | 0.386 |
| Dili | 0.043 |
| Roa | 0.004 |
| Fdamdd | 0.394 |
| Skinsen | 0.953 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.826 |
| Bcf | 1.297 |
| Igc50 | 4.972 |
| Lc50 | 2.438 |
| Lc50dm | 4.013 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.157 |
| Nr-er | 0.074 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.759 |
| Sr-are | 0.785 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.954 |
| Sr-mmp | 0.514 |
| Sr-p53 | 0.051 |
| Vol | 485.904 |
| Dense | 0.879 |
| Flex | 1.9 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.209 |
| Synth | 3.405 |
| Fsp3 | 0.519 |
| Mce-18 | 12 |
| Natural product-likeness | 0.321 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |