| General Information | |
|---|---|
| ZINC ID | ZINC000040874395 |
| Molecular Weight (Da) | 396 |
| SMILES | C[C@H](CO)NC(=O)CCC/C=CC/C=CC/C=CC/C=CCCc1ccccc1 |
| Molecular Formula | C26N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.276 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| LogP | 5.976 |
| Activity (Ki) in nM | 239.883 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.65109825 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.02 |
| Xlogp3 | 6.89 |
| Wlogp | 5.68 |
| Mlogp | 5.28 |
| Silicos-it log p | 5.42 |
| Consensus log p | 5.6 |
| Esol log s | -7.08 |
| Esol solubility (mg/ml) | 0.0000376 |
| Esol solubility (mol/l) | 8.33E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.9 |
| Ali solubility (mg/ml) | 0.0000057 |
| Ali solubility (mol/l) | 1.26E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.92 |
| Silicos-it solubility (mg/ml) | 0.00000542 |
| Silicos-it solubility (mol/l) | 0.00000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.16 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.38 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.04 |
| Logd | 2.509 |
| Logp | 1.824 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.14% |
| Vdss | 1.764 |
| Fu | 1.05% |
| Cyp1a2-inh | 0.297 |
| Cyp1a2-sub | 0.834 |
| Cyp2c19-inh | 0.697 |
| Cyp2c19-sub | 0.099 |
| Cl | 3.9 |
| T12 | 0.955 |
| H-ht | 0.487 |
| Dili | 0.015 |
| Roa | 0.005 |
| Fdamdd | 0.28 |
| Skinsen | 0.961 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.824 |
| Bcf | 1.288 |
| Igc50 | 4.751 |
| Lc50 | 2.904 |
| Lc50dm | 3.842 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.078 |
| Nr-er | 0.058 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.877 |
| Sr-are | 0.691 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.908 |
| Sr-mmp | 0.348 |
| Sr-p53 | 0.028 |
| Vol | 457.181 |
| Dense | 0.865 |
| Flex | 1.455 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.296 |
| Synth | 3.193 |
| Fsp3 | 0.423 |
| Mce-18 | 12 |
| Natural product-likeness | 0.485 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |