| General Information | |
|---|---|
| ZINC ID | ZINC000040875512 |
| Molecular Weight (Da) | 406 |
| SMILES | CC(C)(C(=O)Nc1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| Molecular Formula | C17Cl1F3N1O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 92.378 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 4.395 |
| Activity (Ki) in nM | 34.674 |
| Polar Surface Area (PSA) | 71.62 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.10813736 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.24 |
| Ilogp | 2.24 |
| Xlogp3 | 4.72 |
| Wlogp | 6.59 |
| Mlogp | 4.07 |
| Silicos-it log p | 3.96 |
| Consensus log p | 4.32 |
| Esol log s | -5.28 |
| Esol solubility (mg/ml) | 2.15E-03 |
| Esol solubility (mol/l) | 5.31E-06 |
| Esol class | Moderately |
| Ali log s | -5.95 |
| Ali solubility (mg/ml) | 4.52E-04 |
| Ali solubility (mol/l) | 1.11E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.08 |
| Silicos-it solubility (mg/ml) | 3.36E-05 |
| Silicos-it solubility (mol/l) | 8.28E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.42 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.55 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.391 |
| Logd | 3.521 |
| Logp | 4.009 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 2.46E-05 |
| Ppb | 0.9816 |
| Vdss | 1.265 |
| Fu | 0.0141 |
| Cyp1a2-inh | 0.573 |
| Cyp1a2-sub | 0.87 |
| Cyp2c19-inh | 0.945 |
| Cyp2c19-sub | 0.809 |
| Cl | 1.937 |
| T12 | 0.039 |
| H-ht | 0.571 |
| Dili | 0.972 |
| Roa | 0.207 |
| Fdamdd | 0.273 |
| Skinsen | 0.063 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.087 |
| Bcf | 1.139 |
| Igc50 | 3.686 |
| Lc50 | 4.638 |
| Lc50dm | 5.645 |
| Nr-ar | 0.162 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.643 |
| Nr-aromatase | 0.179 |
| Nr-er | 0.475 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.591 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.816 |
| Sr-p53 | 0.026 |
| Vol | 356.31 |
| Dense | 1.137 |
| Flex | 15 |
| Nstereo | 0.4 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 3 |
| Qed | 2 |
| Synth | 0.811 |
| Fsp3 | 2.16 |
| Mce-18 | 0.235 |
| Natural product-likeness | 20 |
| Alarm nmr | -1.54 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |