| General Information | |
|---|---|
| ZINC ID | ZINC000040878376 |
| Molecular Weight (Da) | 443 |
| SMILES | Fc1ccc(-c2noc(C3CCN(c4cnc5ccc(Cl)cc5c4)CC3)n2)c(Cl)c1 |
| Molecular Formula | C22Cl2F1N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.817 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 5.409 |
| Activity (Ki) in nM | 7.079 |
| Polar Surface Area (PSA) | 55.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.16152882 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.07 |
| Xlogp3 | 5.82 |
| Wlogp | 6.15 |
| Mlogp | 4.73 |
| Silicos-it log p | 5.55 |
| Consensus log p | 5.26 |
| Esol log s | -6.58 |
| Esol solubility (mg/ml) | 0.000118 |
| Esol solubility (mol/l) | 0.00000026 |
| Esol class | Poorly sol |
| Ali log s | -6.75 |
| Ali solubility (mg/ml) | 0.0000794 |
| Ali solubility (mol/l) | 0.00000017 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.09 |
| Silicos-it solubility (mg/ml) | 0.00000036 |
| Silicos-it solubility (mol/l) | 8.13E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.87 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.02 |
| Logd | 4.353 |
| Logp | 6.005 |
| F (20%) | 0.001 |
| F (30%) | 0.04 |
| Mdck | 8.70E-06 |
| Ppb | 1.0014 |
| Vdss | 3.637 |
| Fu | 0.0102 |
| Cyp1a2-inh | 0.865 |
| Cyp1a2-sub | 0.345 |
| Cyp2c19-inh | 0.816 |
| Cyp2c19-sub | 0.061 |
| Cl | 3.119 |
| T12 | 0.029 |
| H-ht | 0.981 |
| Dili | 0.979 |
| Roa | 0.722 |
| Fdamdd | 0.85 |
| Skinsen | 0.601 |
| Ec | 0.003 |
| Ei | 0.026 |
| Respiratory | 0.628 |
| Bcf | 3.278 |
| Igc50 | 4.908 |
| Lc50 | 5.762 |
| Lc50dm | 6.291 |
| Nr-ar | 0.081 |
| Nr-ar-lbd | 0.633 |
| Nr-ahr | 0.941 |
| Nr-aromatase | 0.857 |
| Nr-er | 0.393 |
| Nr-er-lbd | 0.027 |
| Nr-ppar-gamma | 0.132 |
| Sr-are | 0.895 |
| Sr-atad5 | 0.811 |
| Sr-hse | 0.702 |
| Sr-mmp | 0.613 |
| Sr-p53 | 0.931 |
| Vol | 409.188 |
| Dense | 1.08 |
| Flex | 0.107 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.382 |
| Synth | 2.473 |
| Fsp3 | 0.227 |
| Mce-18 | 61.63 |
| Natural product-likeness | -2.244 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |