| General Information | |
|---|---|
| ZINC ID | ZINC000040894766 |
| Molecular Weight (Da) | 432 |
| SMILES | CCOc1ccc(Cc2nc3cc(C(=O)N(CC)CC)ccc3n2Cc2ccco2)cc1 |
| Molecular Formula | C26N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.126 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| LogP | 4.448 |
| Activity (Ki) in nM | 3.311 |
| Polar Surface Area (PSA) | 60.5 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94207638 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.31 |
| Ilogp | 4.19 |
| Xlogp3 | 4.62 |
| Wlogp | 5.15 |
| Mlogp | 2.84 |
| Silicos-it log p | 4.99 |
| Consensus log p | 4.36 |
| Esol log s | -5.23 |
| Esol solubility (mg/ml) | 2.55E-03 |
| Esol solubility (mol/l) | 5.91E-06 |
| Esol class | Moderately |
| Ali log s | -5.62 |
| Ali solubility (mg/ml) | 1.05E-03 |
| Ali solubility (mol/l) | 2.42E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.44 |
| Silicos-it solubility (mg/ml) | 1.57E-06 |
| Silicos-it solubility (mol/l) | 3.65E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.65 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.512 |
| Logd | 3.681 |
| Logp | 4.175 |
| F (20%) | 0.006 |
| F (30%) | 0.012 |
| Mdck | 1.91E-05 |
| Ppb | 0.9744 |
| Vdss | 1.081 |
| Fu | 0.0105 |
| Cyp1a2-inh | 0.386 |
| Cyp1a2-sub | 0.416 |
| Cyp2c19-inh | 0.955 |
| Cyp2c19-sub | 0.083 |
| Cl | 7.757 |
| T12 | 0.621 |
| H-ht | 0.298 |
| Dili | 0.853 |
| Roa | 0.309 |
| Fdamdd | 0.654 |
| Skinsen | 0.037 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.847 |
| Bcf | 2.022 |
| Igc50 | 4.436 |
| Lc50 | 5.929 |
| Lc50dm | 6.438 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.504 |
| Nr-aromatase | 0.66 |
| Nr-er | 0.27 |
| Nr-er-lbd | 0.029 |
| Nr-ppar-gamma | 0.051 |
| Sr-are | 0.821 |
| Sr-atad5 | 0.026 |
| Sr-hse | 0.847 |
| Sr-mmp | 0.357 |
| Sr-p53 | 0.352 |
| Vol | 457.023 |
| Dense | 0.944 |
| Flex | 22 |
| Nstereo | 0.455 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.368 |
| Fsp3 | 2.306 |
| Mce-18 | 0.308 |
| Natural product-likeness | 22 |
| Alarm nmr | -1.947 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |