| General Information | |
|---|---|
| ZINC ID | ZINC000040896947 |
| Molecular Weight (Da) | 363 |
| SMILES | C[C@@H](NS(C)(=O)=O)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C18Cl1N2O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.831 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| LogP | 3.798 |
| Activity (Ki) in nM | 2041.74 |
| Polar Surface Area (PSA) | 78.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94823515 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.28 |
| Ilogp | 2.54 |
| Xlogp3 | 3.81 |
| Wlogp | 4.56 |
| Mlogp | 2.75 |
| Silicos-it log p | 3.72 |
| Consensus log p | 3.48 |
| Esol log s | -4.46 |
| Esol solubility (mg/ml) | 0.0125 |
| Esol solubility (mol/l) | 0.0000343 |
| Esol class | Moderately |
| Ali log s | -5.15 |
| Ali solubility (mg/ml) | 0.00257 |
| Ali solubility (mol/l) | 0.00000708 |
| Ali class | Moderately |
| Silicos-it logsw | -6.82 |
| Silicos-it solubility (mg/ml) | 0.0000548 |
| Silicos-it solubility (mol/l) | 0.00000015 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.81 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.37 |
| Logd | 3.153 |
| Logp | 3.668 |
| F (20%) | 0.003 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 97.69% |
| Vdss | 0.683 |
| Fu | 2.00% |
| Cyp1a2-inh | 0.939 |
| Cyp1a2-sub | 0.724 |
| Cyp2c19-inh | 0.93 |
| Cyp2c19-sub | 0.338 |
| Cl | 7.004 |
| T12 | 0.061 |
| H-ht | 0.812 |
| Dili | 0.96 |
| Roa | 0.073 |
| Fdamdd | 0.947 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.045 |
| Bcf | 1.335 |
| Igc50 | 4.167 |
| Lc50 | 4.758 |
| Lc50dm | 5.012 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.017 |
| Nr-aromatase | 0.029 |
| Nr-er | 0.09 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.038 |
| Sr-are | 0.06 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.076 |
| Sr-p53 | 0.009 |
| Vol | 354.974 |
| Dense | 1.02 |
| Flex | 0.4 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.855 |
| Synth | 3.019 |
| Fsp3 | 0.278 |
| Mce-18 | 30 |
| Natural product-likeness | -1.176 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |