| General Information | |
|---|---|
| ZINC ID | ZINC000040897914 |
| Molecular Weight (Da) | 381 |
| SMILES | Cc1ccc(NC(=O)C2C(C)(C)C2(C)C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C19N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.654 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| LogP | 1.915 |
| Activity (Ki) in nM | 10.965 |
| Polar Surface Area (PSA) | 84.09 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.78475552 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.63 |
| Ilogp | 3.15 |
| Xlogp3 | 2.36 |
| Wlogp | 3.15 |
| Mlogp | 1.62 |
| Silicos-it log p | 2.45 |
| Consensus log p | 2.55 |
| Esol log s | -3.53 |
| Esol solubility (mg/ml) | 0.113 |
| Esol solubility (mol/l) | 0.000297 |
| Esol class | Soluble |
| Ali log s | -3.77 |
| Ali solubility (mg/ml) | 0.0652 |
| Ali solubility (mol/l) | 0.000171 |
| Ali class | Soluble |
| Silicos-it logsw | -4.96 |
| Silicos-it solubility (mg/ml) | 0.00417 |
| Silicos-it solubility (mol/l) | 0.000011 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.95 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.064 |
| Logd | 3.141 |
| Logp | 3.241 |
| F (20%) | 0.042 |
| F (30%) | 0.005 |
| Mdck | 2.18E-05 |
| Ppb | 0.9679 |
| Vdss | 0.803 |
| Fu | 0.0813 |
| Cyp1a2-inh | 0.038 |
| Cyp1a2-sub | 0.119 |
| Cyp2c19-inh | 0.629 |
| Cyp2c19-sub | 0.907 |
| Cl | 5.076 |
| T12 | 0.132 |
| H-ht | 0.329 |
| Dili | 0.979 |
| Roa | 0.16 |
| Fdamdd | 0.504 |
| Skinsen | 0.077 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.225 |
| Bcf | 0.9 |
| Igc50 | 3.054 |
| Lc50 | 3.81 |
| Lc50dm | 4.885 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.283 |
| Nr-aromatase | 0.963 |
| Nr-er | 0.267 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.029 |
| Sr-are | 0.763 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.845 |
| Sr-p53 | 0.011 |
| Vol | 376.628 |
| Dense | 1.009 |
| Flex | 0.278 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.871 |
| Synth | 2.348 |
| Fsp3 | 0.632 |
| Mce-18 | 58.839 |
| Natural product-likeness | -1.632 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |