| General Information | |
|---|---|
| ZINC ID | ZINC000040900126 |
| Molecular Weight (Da) | 395 |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCCC2(C)C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C20N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.433 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 2.826 |
| Activity (Ki) in nM | 10.965 |
| Polar Surface Area (PSA) | 84.09 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.86376726 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.27 |
| Xlogp3 | 3.15 |
| Wlogp | 3.68 |
| Mlogp | 1.85 |
| Silicos-it log p | 2.57 |
| Consensus log p | 2.9 |
| Esol log s | -4.11 |
| Esol solubility (mg/ml) | 0.031 |
| Esol solubility (mol/l) | 0.0000785 |
| Esol class | Moderately |
| Ali log s | -4.59 |
| Ali solubility (mg/ml) | 0.0102 |
| Ali solubility (mol/l) | 0.000026 |
| Ali class | Moderately |
| Silicos-it logsw | -5.02 |
| Silicos-it solubility (mg/ml) | 0.00375 |
| Silicos-it solubility (mol/l) | 0.00000951 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.47 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.76 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.684 |
| Logd | 3.605 |
| Logp | 3.987 |
| F (20%) | 0.045 |
| F (30%) | 0.007 |
| Mdck | 2.89E-05 |
| Ppb | 0.9749 |
| Vdss | 0.839 |
| Fu | 0.0447 |
| Cyp1a2-inh | 0.088 |
| Cyp1a2-sub | 0.18 |
| Cyp2c19-inh | 0.796 |
| Cyp2c19-sub | 0.841 |
| Cl | 6.655 |
| T12 | 0.112 |
| H-ht | 0.354 |
| Dili | 0.954 |
| Roa | 0.14 |
| Fdamdd | 0.36 |
| Skinsen | 0.07 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.213 |
| Bcf | 0.836 |
| Igc50 | 3.931 |
| Lc50 | 4.797 |
| Lc50dm | 4.748 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.012 |
| Nr-ahr | 0.438 |
| Nr-aromatase | 0.939 |
| Nr-er | 0.32 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.053 |
| Sr-are | 0.804 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.024 |
| Sr-mmp | 0.886 |
| Sr-p53 | 0.034 |
| Vol | 393.924 |
| Dense | 1.001 |
| Flex | 0.238 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.851 |
| Synth | 2.846 |
| Fsp3 | 0.65 |
| Mce-18 | 75.727 |
| Natural product-likeness | -1.361 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |