| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040900136 |
| Molecular Weight (Da) | 381 |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCC[C@H]2C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C19N2O4S1 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040900136 |
| Molecular Weight (Da) | 381 |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCC[C@H]2C)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C19N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040900136 |
| Molar Refractivity | 100.958 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| LogP | 2.619 |
| Activity (Ki) in nM | 1819.7 |
| Polar Surface Area (PSA) | 84.09 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000040900136 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.85629117 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.63 |
| Ilogp | 3.17 |
| Xlogp3 | 2.76 |
| Wlogp | 3.29 |
| Mlogp | 1.62 |
| Silicos-it log p | 2.07 |
| Consensus log p | 2.58 |
| Esol log s | -3.78 |
| Esol solubility (mg/ml) | 0.0633 |
| Esol solubility (mol/l) | 0.000166 |
| Esol class | Soluble |
| Ali log s | -4.18 |
| Ali solubility (mg/ml) | 0.0251 |
| Ali solubility (mol/l) | 0.0000659 |
| Ali class | Moderately |
| Silicos-it logsw | -4.43 |
| Silicos-it solubility (mg/ml) | 0.0142 |
| Silicos-it solubility (mol/l) | 0.0000374 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.91 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.2 |
| Logd | 3.341 |
| Logp | 3.562 |
| F (20%) | 0.063 |
| F (30%) | 0.006 |
| Mdck | - |
| Ppb | 97.47% |
| Vdss | 0.748 |
| Fu | 3.19% |
| Cyp1a2-inh | 0.138 |
| Cyp1a2-sub | 0.443 |
| Cyp2c19-inh | 0.739 |
| Cyp2c19-sub | 0.875 |
| Cl | 8.125 |
| T12 | 0.19 |
| H-ht | 0.644 |
| Dili | 0.973 |
| Roa | 0.29 |
| Fdamdd | 0.229 |
| Skinsen | 0.069 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.103 |
| Bcf | 0.697 |
| Igc50 | 3.418 |
| Lc50 | 4.402 |
| Lc50dm | 4.19 |
| Nr-ar | 0.013 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.591 |
| Nr-aromatase | 0.92 |
| Nr-er | 0.27 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.696 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.028 |
| Sr-mmp | 0.792 |
| Sr-p53 | 0.085 |
| Vol | 376.628 |
| Dense | 1.009 |
| Flex | 0.238 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.871 |
| Synth | 2.907 |
| Fsp3 | 0.632 |
| Mce-18 | 69.258 |
| Natural product-likeness | -1.806 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |