| General Information | |
|---|---|
| ZINC ID | ZINC000040913756 |
| Molecular Weight (Da) | 406 |
| SMILES | Cc1ccc(-c2noc(CC3CCCCC3)n2)cc1S(=O)(=O)N1CCOCC1 |
| Molecular Formula | C20N3O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.848 |
| HBA | 6 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 3.053 |
| Activity (Ki) in nM | 741.31 |
| Polar Surface Area (PSA) | 93.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9537853 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.6 |
| Ilogp | 3.8 |
| Xlogp3 | 3.98 |
| Wlogp | 3.89 |
| Mlogp | 2.15 |
| Silicos-it log p | 3.04 |
| Consensus log p | 3.37 |
| Esol log s | -4.82 |
| Esol solubility (mg/ml) | 0.00611 |
| Esol solubility (mol/l) | 0.0000151 |
| Esol class | Moderately |
| Ali log s | -5.65 |
| Ali solubility (mg/ml) | 0.000901 |
| Ali solubility (mol/l) | 0.00000222 |
| Ali class | Moderately |
| Silicos-it logsw | -5.64 |
| Silicos-it solubility (mg/ml) | 0.000929 |
| Silicos-it solubility (mol/l) | 0.00000229 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.95 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.82 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.967 |
| Logd | 3.847 |
| Logp | 4.605 |
| F (20%) | 0.005 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 98.34% |
| Vdss | 1.06 |
| Fu | 1.56% |
| Cyp1a2-inh | 0.477 |
| Cyp1a2-sub | 0.394 |
| Cyp2c19-inh | 0.896 |
| Cyp2c19-sub | 0.095 |
| Cl | 6.312 |
| T12 | 0.102 |
| H-ht | 0.922 |
| Dili | 0.985 |
| Roa | 0.112 |
| Fdamdd | 0.491 |
| Skinsen | 0.049 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.762 |
| Bcf | 1.32 |
| Igc50 | 4.287 |
| Lc50 | 4.481 |
| Lc50dm | 4.115 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.075 |
| Nr-aromatase | 0.734 |
| Nr-er | 0.488 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.051 |
| Sr-are | 0.882 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.103 |
| Sr-mmp | 0.442 |
| Sr-p53 | 0.027 |
| Vol | 393.728 |
| Dense | 1.029 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.759 |
| Synth | 2.381 |
| Fsp3 | 0.6 |
| Mce-18 | 57.75 |
| Natural product-likeness | -2.103 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |