| General Information | |
|---|---|
| ZINC ID | ZINC000040918419 |
| Molecular Weight (Da) | 385 |
| SMILES | CSC(=O)N1CC2(CCCCC2)CS/C1=Nc1cccc2ccccc12 |
| Molecular Formula | C21N2O1S2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.9 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| LogP | 6.242 |
| Activity (Ki) in nM | 48.9779 |
| Polar Surface Area (PSA) | 83.27 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.012 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.53 |
| Xlogp3 | 6.48 |
| Wlogp | 5.93 |
| Mlogp | 4.58 |
| Silicos-it log p | 4.98 |
| Consensus log p | 5.1 |
| Esol log s | -6.39 |
| Esol solubility (mg/ml) | 0.000155 |
| Esol solubility (mol/l) | 0.0000004 |
| Esol class | Poorly sol |
| Ali log s | -8.02 |
| Ali solubility (mg/ml) | 0.00000364 |
| Ali solubility (mol/l) | 9.46E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.42 |
| Silicos-it solubility (mg/ml) | 0.000146 |
| Silicos-it solubility (mol/l) | 0.00000038 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.05 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.683 |
| Logd | 4.805 |
| Logp | 5.927 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.34% |
| Vdss | 1.099 |
| Fu | 1.61% |
| Cyp1a2-inh | 0.901 |
| Cyp1a2-sub | 0.477 |
| Cyp2c19-inh | 0.753 |
| Cyp2c19-sub | 0.554 |
| Cl | 2.561 |
| T12 | 0.016 |
| H-ht | 0.857 |
| Dili | 0.884 |
| Roa | 0.178 |
| Fdamdd | 0.806 |
| Skinsen | 0.651 |
| Ec | 0.006 |
| Ei | 0.41 |
| Respiratory | 0.96 |
| Bcf | 2.488 |
| Igc50 | 4.566 |
| Lc50 | 5.409 |
| Lc50dm | 6.219 |
| Nr-ar | 0.323 |
| Nr-ar-lbd | 0.044 |
| Nr-ahr | 0.927 |
| Nr-aromatase | 0.981 |
| Nr-er | 0.605 |
| Nr-er-lbd | 0.051 |
| Nr-ppar-gamma | 0.422 |
| Sr-are | 0.878 |
| Sr-atad5 | 0.059 |
| Sr-hse | 0.907 |
| Sr-mmp | 0.951 |
| Sr-p53 | 0.788 |
| Vol | 386.893 |
| Dense | 0.993 |
| Flex | 0.12 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 2 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.577 |
| Synth | 3.464 |
| Fsp3 | 0.429 |
| Mce-18 | 74.2 |
| Natural product-likeness | -0.522 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |