| General Information | |
|---|---|
| ZINC ID | ZINC000040918952 |
| Molecular Weight (Da) | 397 |
| SMILES | C[C@@H](CCc1nc(-c2ccc(F)cc2Cl)no1)Nc1cnc2ccccc2c1 |
| Molecular Formula | C21Cl1F1N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.511 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 4.718 |
| Activity (Ki) in nM | 15.136 |
| Polar Surface Area (PSA) | 63.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13517248 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.19 |
| Ilogp | 3.95 |
| Xlogp3 | 5.56 |
| Wlogp | 5.74 |
| Mlogp | 3.63 |
| Silicos-it log p | 5.4 |
| Consensus log p | 4.86 |
| Esol log s | -5.96 |
| Esol solubility (mg/ml) | 0.000433 |
| Esol solubility (mol/l) | 0.00000109 |
| Esol class | Moderately |
| Ali log s | -6.66 |
| Ali solubility (mg/ml) | 0.0000865 |
| Ali solubility (mol/l) | 0.00000021 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.32 |
| Silicos-it solubility (mg/ml) | 0.00000019 |
| Silicos-it solubility (mol/l) | 4.79E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.77 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.81 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.192 |
| Logd | 4.197 |
| Logp | 5.275 |
| F (20%) | 0.001 |
| F (30%) | 0.037 |
| Mdck | 1.04E-05 |
| Ppb | 0.9944 |
| Vdss | 3.094 |
| Fu | 0.0117 |
| Cyp1a2-inh | 0.988 |
| Cyp1a2-sub | 0.353 |
| Cyp2c19-inh | 0.898 |
| Cyp2c19-sub | 0.062 |
| Cl | 3.385 |
| T12 | 0.044 |
| H-ht | 0.989 |
| Dili | 0.98 |
| Roa | 0.137 |
| Fdamdd | 0.938 |
| Skinsen | 0.206 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.929 |
| Bcf | 2.31 |
| Igc50 | 4.423 |
| Lc50 | 4.579 |
| Lc50dm | 5.574 |
| Nr-ar | 0.686 |
| Nr-ar-lbd | 0.654 |
| Nr-ahr | 0.958 |
| Nr-aromatase | 0.648 |
| Nr-er | 0.602 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.451 |
| Sr-are | 0.902 |
| Sr-atad5 | 0.589 |
| Sr-hse | 0.533 |
| Sr-mmp | 0.639 |
| Sr-p53 | 0.868 |
| Vol | 385.238 |
| Dense | 1.028 |
| Flex | 0.273 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.465 |
| Synth | 2.81 |
| Fsp3 | 0.19 |
| Mce-18 | 42 |
| Natural product-likeness | -2.178 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |