| General Information | |
|---|---|
| ZINC ID | ZINC000040933206 |
| Molecular Weight (Da) | 460 |
| SMILES | Cc1c(-c2nnc(C3CCC3)o2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.446 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 6.721 |
| Activity (Ki) in nM | 38.9045 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.145 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.23 |
| Xlogp3 | 6.26 |
| Wlogp | 7.13 |
| Mlogp | 5.24 |
| Silicos-it log p | 6.37 |
| Consensus log p | 5.85 |
| Esol log s | -6.91 |
| Esol solubility (mg/ml) | 0.0000562 |
| Esol solubility (mol/l) | 0.00000012 |
| Esol class | Poorly sol |
| Ali log s | -7.24 |
| Ali solubility (mg/ml) | 0.0000265 |
| Ali solubility (mol/l) | 5.77E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.41 |
| Silicos-it solubility (mg/ml) | 0.00000017 |
| Silicos-it solubility (mol/l) | 3.90E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.66 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.961 |
| Logd | 4.683 |
| Logp | 6.196 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 98.93% |
| Vdss | 2.98 |
| Fu | 1.55% |
| Cyp1a2-inh | 0.462 |
| Cyp1a2-sub | 0.642 |
| Cyp2c19-inh | 0.73 |
| Cyp2c19-sub | 0.075 |
| Cl | 2.219 |
| T12 | 0.031 |
| H-ht | 0.267 |
| Dili | 0.932 |
| Roa | 0.86 |
| Fdamdd | 0.897 |
| Skinsen | 0.035 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.866 |
| Bcf | 3.614 |
| Igc50 | 5.091 |
| Lc50 | 6.136 |
| Lc50dm | 6.226 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.112 |
| Nr-ahr | 0.277 |
| Nr-aromatase | 0.963 |
| Nr-er | 0.782 |
| Nr-er-lbd | 0.171 |
| Nr-ppar-gamma | 0.032 |
| Sr-are | 0.953 |
| Sr-atad5 | 0.446 |
| Sr-hse | 0.276 |
| Sr-mmp | 0.84 |
| Sr-p53 | 0.868 |
| Vol | 418.332 |
| Dense | 1.095 |
| Flex | 0.154 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.326 |
| Synth | 2.578 |
| Fsp3 | 0.227 |
| Mce-18 | 62 |
| Natural product-likeness | -1.426 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |