| General Information | |
|---|---|
| ZINC ID | ZINC000040934468 |
| Molecular Weight (Da) | 369 |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2cccc(F)c2)cc1C1CC1 |
| Molecular Formula | C21F1N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.076 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| LogP | 3.427 |
| Activity (Ki) in nM | 2511.886 |
| Polar Surface Area (PSA) | 63.25 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.80424642 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.15 |
| Xlogp3 | 3.61 |
| Wlogp | 4.36 |
| Mlogp | 3.04 |
| Silicos-it log p | 4.07 |
| Consensus log p | 3.65 |
| Esol log s | -4.27 |
| Esol solubility (mg/ml) | 1.98E-02 |
| Esol solubility (mol/l) | 5.35E-05 |
| Esol class | Moderately |
| Ali log s | -4.63 |
| Ali solubility (mg/ml) | 8.75E-03 |
| Ali solubility (mol/l) | 2.37E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.72 |
| Silicos-it solubility (mg/ml) | 7.01E-05 |
| Silicos-it solubility (mol/l) | 1.90E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.99 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.249 |
| Logd | 3.493 |
| Logp | 3.752 |
| F (20%) | 0.002 |
| F (30%) | 0.032 |
| Mdck | 2.59E-05 |
| Ppb | 0.9501 |
| Vdss | 0.662 |
| Fu | 0.0362 |
| Cyp1a2-inh | 0.49 |
| Cyp1a2-sub | 0.376 |
| Cyp2c19-inh | 0.931 |
| Cyp2c19-sub | 0.068 |
| Cl | 4.696 |
| T12 | 0.088 |
| H-ht | 0.889 |
| Dili | 0.353 |
| Roa | 0.904 |
| Fdamdd | 0.939 |
| Skinsen | 0.728 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.288 |
| Bcf | 1.593 |
| Igc50 | 4.194 |
| Lc50 | 4.475 |
| Lc50dm | 6.566 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.92 |
| Nr-aromatase | 0.955 |
| Nr-er | 0.161 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.048 |
| Sr-are | 0.39 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.778 |
| Sr-mmp | 0.659 |
| Sr-p53 | 0.082 |
| Vol | 375.729 |
| Dense | 0.983 |
| Flex | 23 |
| Nstereo | 0.261 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.848 |
| Fsp3 | 2.968 |
| Mce-18 | 0.429 |
| Natural product-likeness | 50.667 |
| Alarm nmr | -1.097 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |