| General Information | |
|---|---|
| ZINC ID | ZINC000040936033 |
| Molecular Weight (Da) | 448 |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)cc2Cl)cc1C(F)(F)F |
| Molecular Formula | C19Cl2F3N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.054 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 4.67 |
| Activity (Ki) in nM | 50.119 |
| Polar Surface Area (PSA) | 63.25 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.82884341 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.37 |
| Ilogp | 3.31 |
| Xlogp3 | 4.74 |
| Wlogp | 6.46 |
| Mlogp | 3.53 |
| Silicos-it log p | 5.04 |
| Consensus log p | 4.61 |
| Esol log s | -5.45 |
| Esol solubility (mg/ml) | 1.59E-03 |
| Esol solubility (mol/l) | 3.55E-06 |
| Esol class | Moderately |
| Ali log s | -5.8 |
| Ali solubility (mg/ml) | 7.13E-04 |
| Ali solubility (mol/l) | 1.59E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.89 |
| Silicos-it solubility (mg/ml) | 5.75E-06 |
| Silicos-it solubility (mol/l) | 1.28E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.67 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.78 |
| Logd | 3.961 |
| Logp | 4.425 |
| F (20%) | 0.004 |
| F (30%) | 0.004 |
| Mdck | 1.43E-05 |
| Ppb | 0.9851 |
| Vdss | 2.705 |
| Fu | 0.0175 |
| Cyp1a2-inh | 0.505 |
| Cyp1a2-sub | 0.598 |
| Cyp2c19-inh | 0.965 |
| Cyp2c19-sub | 0.101 |
| Cl | 5.56 |
| T12 | 0.052 |
| H-ht | 0.919 |
| Dili | 0.772 |
| Roa | 0.837 |
| Fdamdd | 0.95 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.424 |
| Bcf | 2.11 |
| Igc50 | 4.642 |
| Lc50 | 5.867 |
| Lc50dm | 6.648 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.934 |
| Nr-aromatase | 0.959 |
| Nr-er | 0.237 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.645 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.801 |
| Sr-mmp | 0.825 |
| Sr-p53 | 0.55 |
| Vol | 392.251 |
| Dense | 1.14 |
| Flex | 20 |
| Nstereo | 0.3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 1 |
| Synth | 0.711 |
| Fsp3 | 3.011 |
| Mce-18 | 0.368 |
| Natural product-likeness | 47.692 |
| Alarm nmr | -1.331 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |