| General Information | |
|---|---|
| ZINC ID | ZINC000040936796 |
| Molecular Weight (Da) | 478 |
| SMILES | Cc1c(-c2nnc(CC(C)C)s2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N4S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.823 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| LogP | 7.44 |
| Activity (Ki) in nM | 28.1838 |
| Polar Surface Area (PSA) | 71.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.015 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.72 |
| Xlogp3 | 7.39 |
| Wlogp | 7.52 |
| Mlogp | 5.26 |
| Silicos-it log p | 7.95 |
| Consensus log p | 6.57 |
| Esol log s | -7.67 |
| Esol solubility (mg/ml) | 0.0000102 |
| Esol solubility (mol/l) | 2.13E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.73 |
| Ali solubility (mg/ml) | 0.00000089 |
| Ali solubility (mol/l) | 1.87E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.79 |
| Silicos-it solubility (mg/ml) | 7.66E-08 |
| Silicos-it solubility (mol/l) | 1.60E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.97 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.96 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.254 |
| Logd | 5.658 |
| Logp | 6.714 |
| F (20%) | 0.001 |
| F (30%) | 0.138 |
| Mdck | - |
| Ppb | 99.86% |
| Vdss | 1.388 |
| Fu | 2.13% |
| Cyp1a2-inh | 0.468 |
| Cyp1a2-sub | 0.45 |
| Cyp2c19-inh | 0.802 |
| Cyp2c19-sub | 0.141 |
| Cl | 1.828 |
| T12 | 0.018 |
| H-ht | 0.347 |
| Dili | 0.934 |
| Roa | 0.217 |
| Fdamdd | 0.809 |
| Skinsen | 0.022 |
| Ec | 0.003 |
| Ei | 0.023 |
| Respiratory | 0.071 |
| Bcf | 3.607 |
| Igc50 | 4.936 |
| Lc50 | 5.886 |
| Lc50dm | 5.744 |
| Nr-ar | 0.115 |
| Nr-ar-lbd | 0.155 |
| Nr-ahr | 0.248 |
| Nr-aromatase | 0.905 |
| Nr-er | 0.907 |
| Nr-er-lbd | 0.498 |
| Nr-ppar-gamma | 0.04 |
| Sr-are | 0.953 |
| Sr-atad5 | 0.724 |
| Sr-hse | 0.096 |
| Sr-mmp | 0.924 |
| Sr-p53 | 0.855 |
| Vol | 436.607 |
| Dense | 1.09 |
| Flex | 0.227 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.298 |
| Synth | 2.614 |
| Fsp3 | 0.227 |
| Mce-18 | 24 |
| Natural product-likeness | -1.496 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |