| General Information | |
|---|---|
| ZINC ID | ZINC000040939649 |
| Molecular Weight (Da) | 479 |
| SMILES | CCCCCC(=O)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| Molecular Formula | C23Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.32 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| LogP | 7.468 |
| Activity (Ki) in nM | 33.8844 |
| Polar Surface Area (PSA) | 63.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.26 |
| Ilogp | 3.95 |
| Xlogp3 | 7.1 |
| Wlogp | 6.64 |
| Mlogp | 5.21 |
| Silicos-it log p | 6.56 |
| Consensus log p | 5.89 |
| Esol log s | -7.09 |
| Esol solubility (mg/ml) | 0.0000386 |
| Esol solubility (mol/l) | 8.07E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.26 |
| Ali solubility (mg/ml) | 0.00000262 |
| Ali solubility (mol/l) | 5.46E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.48 |
| Silicos-it solubility (mg/ml) | 0.00000015 |
| Silicos-it solubility (mol/l) | 3.31E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.18 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.29 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.003 |
| Logd | 5.137 |
| Logp | 6.375 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.60% |
| Vdss | 0.856 |
| Fu | 1.90% |
| Cyp1a2-inh | 0.2 |
| Cyp1a2-sub | 0.431 |
| Cyp2c19-inh | 0.84 |
| Cyp2c19-sub | 0.194 |
| Cl | 3.1 |
| T12 | 0.074 |
| H-ht | 0.272 |
| Dili | 0.959 |
| Roa | 0.618 |
| Fdamdd | 0.242 |
| Skinsen | 0.077 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.018 |
| Bcf | 2.937 |
| Igc50 | 5.136 |
| Lc50 | 6.096 |
| Lc50dm | 5.954 |
| Nr-ar | 0.052 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.921 |
| Nr-aromatase | 0.872 |
| Nr-er | 0.727 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.919 |
| Sr-are | 0.913 |
| Sr-atad5 | 0.337 |
| Sr-hse | 0.26 |
| Sr-mmp | 0.939 |
| Sr-p53 | 0.952 |
| Vol | 450.534 |
| Dense | 1.059 |
| Flex | 0.474 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.387 |
| Synth | 2.329 |
| Fsp3 | 0.261 |
| Mce-18 | 20 |
| Natural product-likeness | -1.2 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |