| General Information | |
|---|---|
| ZINC ID | ZINC000040943678 |
| Molecular Weight (Da) | 498 |
| SMILES | O=C(NCc1cccc(Cl)c1)c1ccc2c(c1)N=C(N1CCC(F)(F)CC1)c1ccccc1S2 |
| Molecular Formula | C26Cl1F2N3O1S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.685 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| LogP | 6.171 |
| Activity (Ki) in nM | 1258.925 |
| Polar Surface Area (PSA) | 70 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.057 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.86 |
| Xlogp3 | 5.72 |
| Wlogp | 6.47 |
| Mlogp | 5.59 |
| Silicos-it log p | 6.64 |
| Consensus log p | 5.66 |
| Esol log s | -6.59 |
| Esol solubility (mg/ml) | 0.000127 |
| Esol solubility (mol/l) | 0.00000025 |
| Esol class | Poorly sol |
| Ali log s | -6.96 |
| Ali solubility (mg/ml) | 0.000055 |
| Ali solubility (mol/l) | 0.00000011 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.96 |
| Silicos-it solubility (mg/ml) | 5.41E-08 |
| Silicos-it solubility (mol/l) | 1.09E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.28 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.923 |
| Logd | 4.091 |
| Logp | 5.224 |
| F (20%) | 0.008 |
| F (30%) | 0.205 |
| Mdck | 1.04E-05 |
| Ppb | 0.9807 |
| Vdss | 1.006 |
| Fu | 0.0065 |
| Cyp1a2-inh | 0.404 |
| Cyp1a2-sub | 0.908 |
| Cyp2c19-inh | 0.903 |
| Cyp2c19-sub | 0.31 |
| Cl | 3.665 |
| T12 | 0.016 |
| H-ht | 0.604 |
| Dili | 0.921 |
| Roa | 0.714 |
| Fdamdd | 0.736 |
| Skinsen | 0.109 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.765 |
| Bcf | 1.517 |
| Igc50 | 5.347 |
| Lc50 | 5.546 |
| Lc50dm | 6.549 |
| Nr-ar | 0.174 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.692 |
| Nr-aromatase | 0.407 |
| Nr-er | 0.297 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.073 |
| Sr-are | 0.514 |
| Sr-atad5 | 0.021 |
| Sr-hse | 0.04 |
| Sr-mmp | 0.787 |
| Sr-p53 | 0.406 |
| Vol | 474.104 |
| Dense | 1.049 |
| Flex | 0.167 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 1 |
| Qed | 0.446 |
| Synth | 2.699 |
| Fsp3 | 0.231 |
| Mce-18 | 64.75 |
| Natural product-likeness | -1.252 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Accepted |