| General Information | |
|---|---|
| ZINC ID | ZINC000040955070 |
| Molecular Weight (Da) | 414 |
| SMILES | Clc1cccc(Nc2ccc(CN3CCO[C@@H](c4ccccc4)C3)cn2)c1Cl |
| Molecular Formula | C22Cl2N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.21 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.474 |
| Activity (Ki) in nM | 1584.893 |
| Polar Surface Area (PSA) | 37.39 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.1830784 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.97 |
| Xlogp3 | 4.97 |
| Wlogp | 4.85 |
| Mlogp | 3.85 |
| Silicos-it log p | 4.85 |
| Consensus log p | 4.5 |
| Esol log s | -5.69 |
| Esol solubility (mg/ml) | 8.54E-04 |
| Esol solubility (mol/l) | 2.06E-06 |
| Esol class | Moderately |
| Ali log s | -5.49 |
| Ali solubility (mg/ml) | 1.33E-03 |
| Ali solubility (mol/l) | 3.21E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.61 |
| Silicos-it solubility (mg/ml) | 1.01E-06 |
| Silicos-it solubility (mol/l) | 2.44E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.3 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.928 |
| Logd | 4.269 |
| Logp | 5.06 |
| F (20%) | 0.17 |
| F (30%) | 0.75 |
| Mdck | 1.98E-05 |
| Ppb | 0.9783 |
| Vdss | 2.57 |
| Fu | 0.0149 |
| Cyp1a2-inh | 0.707 |
| Cyp1a2-sub | 0.927 |
| Cyp2c19-inh | 0.903 |
| Cyp2c19-sub | 0.082 |
| Cl | 8.957 |
| T12 | 0.042 |
| H-ht | 0.916 |
| Dili | 0.955 |
| Roa | 0.828 |
| Fdamdd | 0.935 |
| Skinsen | 0.562 |
| Ec | 0.004 |
| Ei | 0.018 |
| Respiratory | 0.978 |
| Bcf | 2.859 |
| Igc50 | 5.018 |
| Lc50 | 6.743 |
| Lc50dm | 6.701 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.03 |
| Nr-ahr | 0.882 |
| Nr-aromatase | 0.953 |
| Nr-er | 0.338 |
| Nr-er-lbd | 0.021 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.654 |
| Sr-atad5 | 0.046 |
| Sr-hse | 0.74 |
| Sr-mmp | 0.723 |
| Sr-p53 | 0.556 |
| Vol | 403.317 |
| Dense | 1.024 |
| Flex | 25 |
| Nstereo | 0.16 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.643 |
| Fsp3 | 3.295 |
| Mce-18 | 0.227 |
| Natural product-likeness | 65.926 |
| Alarm nmr | -1.13 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |